CAS 59834-94-5
:1,2,4,6-Tetraphenyl pyridinium tetrafluoborate
Description:
1,2,4,6-Tetraphenyl pyridinium tetrafluoroborate is a quaternary ammonium salt characterized by its complex structure, which includes a pyridinium cation and a tetrafluoroborate anion. This compound is typically used as a reagent in organic synthesis and electrochemistry due to its ability to facilitate electron transfer processes. It is known for its stability and solubility in polar organic solvents, making it suitable for various applications in chemical research. The presence of four phenyl groups on the pyridinium ring contributes to its hydrophobic characteristics, while the tetrafluoroborate anion enhances its ionic properties. This compound is often utilized in studies involving ionic liquids and as a phase transfer catalyst. Safety precautions should be observed when handling this substance, as it may pose risks associated with its chemical reactivity and potential toxicity. Overall, 1,2,4,6-Tetraphenyl pyridinium tetrafluoroborate is a valuable compound in the field of synthetic and analytical chemistry.
Formula:C29H22BF4N
InChI:InChI=1/C29H22N.BF4/c1-5-13-23(14-6-1)26-21-28(24-15-7-2-8-16-24)30(27-19-11-4-12-20-27)29(22-26)25-17-9-3-10-18-25;2-1(3,4)5/h1-22H;/q+1;-1
Synonyms:- 1,2,4,6-Tetraphenylpyridinium tetrafluoroborate
- 1,2,4,6-Tetraphenylpyridin-1-Ium Tetrafluoroborate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-Phenyl-2,4,6-triphenyl pyridinium tetrafluoroborate
CAS:<p>N-Phenyl-2,4,6-triphenyl pyridinium tetrafluoroborate is a crystalline material that is insoluble in water and organic solvents. It can be used as a monomer in the synthesis of polymers and for immobilization of enzymes. N-Phenyl-2,4,6-triphenyl pyridinium tetrafluoroborate can be used to reprocess technetium and has been shown to diffract x-rays with high resolution. This compound is also fluorescent with a long wavelength (620 nm) and can be used as a radioactive tracer.</p>Formula:C29H22N·BF4Purity:Min. 95%Molecular weight:471.3 g/mol
