CAS 59837-14-8: P-nitrophenyl 2-acetamido-2-deoxy-3-O-*(B-D-galac
Description:P-nitrophenyl 2-acetamido-2-deoxy-3-O-(β-D-galactopyranoside), commonly referred to as a glycoside, is a chemical compound characterized by its structure, which includes a p-nitrophenyl group and a galactopyranoside moiety. This compound is typically used in biochemical applications, particularly in enzyme assays, due to its ability to release p-nitrophenol upon hydrolysis. The presence of the acetamido group contributes to its stability and solubility in aqueous solutions. It is often utilized as a substrate for galactosidase enzymes, allowing researchers to study enzyme kinetics and activity. The compound is generally stable under standard laboratory conditions but should be handled with care due to the potential toxicity of p-nitrophenol. Its molecular structure allows for specific interactions with biological molecules, making it a valuable tool in glycoscience and enzymology. As with all chemical substances, proper safety protocols should be followed when handling this compound in a laboratory setting.
Formula:C20H28N2O13
InChI:InChI=1/C20H28N2O13/c1-8(25)21-13-18(35-20-17(29)16(28)14(26)11(6-23)34-20)15(27)12(7-24)33-19(13)32-10-4-2-9(3-5-10)22(30)31/h2-5,11-20,23-24,26-29H,6-7H2,1H3,(H,21,25)/t11-,12-,13-,14+,15+,16+,17-,18?,19+,20+/m1/s1
- Synonyms:
- T Antigen, p-Nitrophenyl-
- 4-nitrophenyl (3xi)-2-(acetylamino)-2-deoxy-3-O-beta-D-galactopyranosyl-alpha-D-xylo-hexopyranoside