CAS 59840-67-4

2H-[1,2,3]triazolo[4,5-d]pyrimidine-5,7(3H,6H)-dione hydrate

Description:

2H-[1,2,3]triazolo[4,5-d]pyrimidine-5,7(3H,6H)-dione hydrate is a heterocyclic compound characterized by its triazole and pyrimidine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is known for its potential biological activities, including antimicrobial and antitumor properties. The presence of the hydrate indicates that it contains water molecules in its crystalline structure, which can influence its solubility and stability. The molecular structure features nitrogen atoms that are integral to the triazole and pyrimidine moieties, affecting its reactivity and interaction with other chemical species. This compound is of interest in medicinal chemistry and may serve as a scaffold for the development of new pharmaceuticals. Its CAS number, 59840-67-4, allows for easy identification and retrieval of information in chemical databases. Overall, 2H-[1,2,3]triazolo[4,5-d]pyrimidine-5,7(3H,6H)-dione hydrate represents a valuable compound in the field of organic and medicinal chemistry.

Formula: C₄H₅N₅O₃

InChI: InChI=1/C4H3N5O2.H2O/c10-3-1-2(8-9-7-1)5-4(11)6-3;/h(H3,5,6,7,8,9,10,11);1H2

SMILES: c12c(nc(nc1O)O)[nH]nn2.O

8-Azaxanthine Monohydrate

Controlled Product

CAS: 59840-67-4

Applications 8-Azaxanthine Monohydrate (cas# 59840-67-4) is a compound useful in organic synthesis.
References Balnk, U.H., et al.: JOC, 35, 4, 1131 (1970)

Formula: C₄H₃N₅O₂·H₂O

Color and Shape: Neat

Molecular weight: 171.11

Ref: TR-A806050