CAS 59843-83-3

2-Chloro-N,N-dimethylbutanamide

Description:

2-Chloro-N,N-dimethylbutanamide is an organic compound characterized by its amide functional group, which is derived from butanoic acid. The presence of a chlorine atom at the second carbon position of the butanamide structure contributes to its reactivity and potential applications in organic synthesis. This compound features two methyl groups attached to the nitrogen atom, which influences its steric and electronic properties, making it a tertiary amide. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is soluble in organic solvents and may exhibit moderate polarity due to the amide group. Its chemical properties allow it to participate in various reactions, including nucleophilic substitutions and coupling reactions, making it useful in the synthesis of pharmaceuticals and agrochemicals. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested. Overall, 2-Chloro-N,N-dimethylbutanamide is a versatile compound in synthetic organic chemistry.

Formula: C₆H₁₂ClNO

InChI: InChI=1S/C6H12ClNO/c1-4-5(7)6(9)8(2)3/h5H,4H2,1-3H3

InChI key: InChIKey=UCELCVSCXNSTPP-UHFFFAOYSA-N

SMILES: C(C(CC)Cl)(N(C)C)=O

Synonyms:

• 2-Chloro-N,N-dimethylbutyramide
• butanamide, 2-chloro-N,N-dimethyl-
• 2-Chloro-N,N-dimethylbutanamide