CAS 5985-38-6
:Morphinan-3-ol, 17-methyl-, (2S,3S)-2,3-dihydroxybutanedioate, hydrate (1:1:2)
Description:
Morphinan-3-ol, 17-methyl-, (2S,3S)-2,3-dihydroxybutanedioate, hydrate (1:1:2), with CAS number 5985-38-6, is a chemical compound that belongs to the morphinan class of alkaloids, which are derived from opium. This substance is characterized by its complex structure, featuring a morphinan backbone with hydroxyl groups and a dihydroxybutanedioate moiety. It typically appears as a crystalline solid and is soluble in polar solvents due to the presence of hydroxyl groups. The compound exhibits biological activity, often related to its interaction with opioid receptors, which can influence pain modulation and other physiological processes. Its hydrate form indicates the presence of water molecules in the crystal structure, which can affect its stability and solubility. Morphinan derivatives are of significant interest in medicinal chemistry for their potential therapeutic applications, including analgesic and antitussive effects. However, the specific pharmacological properties and safety profile of this compound would require further investigation through empirical studies.
Formula:C17H23NO·C4H6O6·2H2O
InChI:InChI=1S/C17H23NO.C4H6O6.H2O/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17;5-1(3(7)8)2(6)4(9)10;/h5-6,11,14,16,19H,2-4,7-10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10);1H2/t14-,16+,17+;1-,2-;/m00./s1
InChI key:InChIKey=FVLRMKYACTYDNC-AXMCENDZSA-N
SMILES:[C@H]([C@@H](C(O)=O)O)(C(O)=O)O.CN1[C@]2([C@]3([C@](C=4C(C2)=CC=C(O)C4)(CC1)CCCC3)[H])[H].O
Synonyms:- 17-Methylmorphinan-3-Ol 2,3-Dihydroxybutanedioate Dihydrate (Salt)
- Levorphanol <span class="text-smallcaps">D</span>-tartrate dihydrate
- Levorphanol Tartrate--Dea Schedule Ii*Item
- Levorphanol tartrate dihydrate
- Morphinan-3-ol, 17-methyl-, (2S,3S)-2,3-dihydroxybutanedioate (1:1) (salt), dihydrate
- Morphinan-3-ol, 17-methyl-, (2S,3S)-2,3-dihydroxybutanedioate, hydrate (1:1:2)
- Morphinan-3-ol, 17-methyl-, [S-(R*,R*)]-2,3-dihydroxybutanedioate (1:1) (salt), dihydrate
- Morphinan-3-ol, N-methyl-, <span class="text-smallcaps">D</span>-tartrate, dihydrate (1:1), (-)-
- l-3-Hydroxy-N-methylmorphinan <span class="text-smallcaps">D</span>-tartrate dihydrate
- l-3-Hydroxy-N-methylmorphinan D-tartrate dihydrate
- Morphinan-3-ol, N-methyl-, D-tartrate, dihydrate (1:1), (-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Levorphanol Tartrate CII
CAS:Controlled ProductLevorphanol (inn) and its saltsFormula:C17H23NO·C4H6O6·2H2OColor and Shape:White Crystalline PowderMolecular weight:257.17796

