CAS 59855-11-7

4-carbamimidoylbenzamide hydrochloride

Description:

4-Carbamimidoylbenzamide hydrochloride, with the CAS number 59855-11-7, is a chemical compound characterized by its structural features that include a benzamide moiety and a carbamimidoyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which enhances its utility in biological and chemical applications. It is often studied for its potential pharmacological properties, particularly in the context of enzyme inhibition and as a building block in medicinal chemistry. The presence of the hydrochloride salt form indicates that it is a stable, ionized compound, which can influence its solubility and bioavailability. Additionally, 4-carbamimidoylbenzamide hydrochloride may exhibit specific reactivity patterns due to the functional groups present, making it of interest in synthetic organic chemistry and drug development. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₈H₁₀ClN₃O

InChI: InChI=1/C8H9N3O.ClH/c9-7(10)5-1-3-6(4-2-5)8(11)12;/h1-4H,(H3,9,10)(H2,11,12);1H

SMILES: c1cc(ccc1C(=N)N)C(=O)N.Cl

4-Amidinobenzamide Hydrochloride

CAS: 59855-11-7

Formula: C₈H₉N₃O·HCl

Purity: >92.0%(HPLC)(N)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 199.64

Ref: 3B-A1062

4-Amidinobenzamide, HCl

CAS: 59855-11-7

Formula: C₈H₁₀ClN₃O

Purity: 92%

Color and Shape: Solid

Molecular weight: 199.6375

Ref: IN-DA003KNA

4-Carbamimidoylbenzamide Hydrochloride

CAS: 59855-11-7

4-Carbamimidoylbenzamide Hydrochloride

Purity: 98%

Molecular weight: 199.64g/mol

Ref: 54-OR1011484

4-Amidinobenzamide hydrochloride

CAS: 59855-11-7

Formula: C₈H₁₀ClN₃O

Purity: 92.0%

Color and Shape: Solid

Molecular weight: 199.64

Ref: 10-F047793