CymitQuimica logo

CAS 59860-99-0

:

(9xi,11beta)-9-fluoro-11,21-dihydroxy-16-methylpregna-1,4,16-triene-3,20-dione

Description:
The chemical substance known as (9xi,11beta)-9-fluoro-11,21-dihydroxy-16-methylpregna-1,4,16-triene-3,20-dione, with the CAS number 59860-99-0, is a synthetic corticosteroid. It exhibits anti-inflammatory and immunosuppressive properties, making it useful in various therapeutic applications, particularly in the treatment of conditions such as asthma, allergies, and autoimmune disorders. The structure of this compound features a fluorine atom, which enhances its potency and metabolic stability compared to other corticosteroids. Additionally, the presence of hydroxyl groups contributes to its biological activity by influencing receptor binding and pharmacokinetics. This compound is characterized by its steroidal backbone, which is typical of corticosteroids, and its specific configuration at various chiral centers, which is crucial for its interaction with biological targets. As with many corticosteroids, it may have side effects, including potential impacts on metabolism and immune function, necessitating careful consideration in clinical use.
Formula:C22H27FO4
InChI:InChI=1/C22H27FO4/c1-12-8-16-15-5-4-13-9-14(25)6-7-21(13,3)22(15,23)18(27)10-20(16,2)19(12)17(26)11-24/h6-7,9,15-16,18,24,27H,4-5,8,10-11H2,1-3H3/t15-,16-,18-,20-,21-,22?/m0/s1
SMILES:CC1=C(C(=O)CO)[C@@]2(C)C[C@@H](C3([C@@H](CCC4=CC(=O)C=C[C@]34C)[C@@H]2C1)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.