CAS 59865-15-5
:(3S,6S,9R,12R,15S,18S,21S,24S,30S)-30-ethyl-33-[(1R,2R)-1-hydroxy-2-methylhexyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,
Description:
The chemical substance with the name "(3S,6S,9R,12R,15S,18S,21S,24S,30S)-30-ethyl-33-[(1R,2R)-1-hydroxy-2-methylhexyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26" and CAS number "59865-15-5" is a complex organic compound characterized by its extensive polycyclic structure and multiple chiral centers. This compound features a large number of methyl and propyl substituents, contributing to its hydrophobic nature and potentially influencing its solubility and interaction with biological membranes. The presence of hydroxy and ethyl groups suggests it may exhibit some degree of polarity, which could affect its reactivity and biological activity. Additionally, the multiple azacycloalkane units indicate potential applications in medicinal chemistry, particularly in drug design or as a scaffold for further chemical modifications. Its intricate stereochemistry may also play a crucial role in determining its biological function and pharmacokinetics. Overall, this compound exemplifies the complexity often found in synthetic organic chemistry and its potential implications in various fields.
Formula:C62H113N11O12
InChI:InChI=1/C62H113N11O12/c1-25-27-28-40(15)52(75)51-56(79)65-43(26-2)58(81)67(18)33-48(74)68(19)44(29-34(3)4)55(78)66-49(38(11)12)61(84)69(20)45(30-35(5)6)54(77)63-41(16)53(76)64-42(17)57(80)70(21)46(31-36(7)8)59(82)71(22)47(32-37(9)10)60(83)72(23)50(39(13)14)62(85)73(51)24/h34-47,49-52,75H,25-33H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78)/t40-,41+,42-,43+,44+,45+,46-,47+,49+,50+,51?,52-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ciclosporin EP Impurity B (Dihydrocyclosporin A)
CAS:Formula:C62H113N11O12Color and Shape:Off-White SolidMolecular weight:1204.65Dihydrocyclosporin A
CAS:Dihydrocyclosporin A (Dihydrocyclosporin-A) is closely related co-metabolite of cyclosporin A.Formula:C62H113N11O12Purity:95% - 99.96%Color and Shape:SolidMolecular weight:1204.63Ref: TM-T31467
1mg120.00€5mg289.00€10mg424.00€25mg695.00€1mL*10mM (DMSO)705.00€50mg973.00€100mg1,314.00€Dihydro Cyclosporin A
CAS:Controlled ProductApplications A Cyclosporin A (C988900) analog, an immunosuppressant.
References Emmer, G., et al.: J. Med. Chem., 37, 1918 (1994), High, K., et al.: J. Biol. Chem., 269, 9105 (1994),Formula:C62H113N11O12Color and Shape:WhiteMolecular weight:1204.63Dihydrocyclosporin A
CAS:Dihydrocyclosporin A is an immunosuppressant, which is a cyclic undecapeptide derived from fungal metabolites, specifically from the soil fungus Tolypocladium inflatum. This compound functions through the inhibition of calcineurin, which is a crucial phosphatase involved in the activation of T-cells. By binding to the intracellular protein cyclophilin, Dihydrocyclosporin A forms a complex that inhibits calcineurin activity, subsequently blocking the transcription of interleukin-2 and other cytokines essential for T-cell proliferation.
Formula:C62H113N11O12Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:1,204.63 g/mol






