CAS 59865-23-5
:4-[(2E)-but-2-en-1-yl]-2,4,5-trideoxy-2-(methylamino)-L-xylonic acid
Description:
4-[(2E)-but-2-en-1-yl]-2,4,5-trideoxy-2-(methylamino)-L-xylonic acid, with the CAS number 59865-23-5, is a chemical compound characterized by its unique structural features. It contains a butenyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of a methylamino group indicates that it may exhibit basic properties and could participate in various chemical reactions, such as nucleophilic substitutions. The trideoxy nature of the compound suggests that it lacks three hydroxyl groups typically found in sugars, which may influence its solubility and biological activity. This compound is likely to be of interest in biochemical research, particularly in the study of carbohydrate derivatives and their interactions in biological systems. Its specific stereochemistry, denoted by the L-configuration, may also play a crucial role in its biological function and interactions with enzymes or receptors. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C10H19NO3
InChI:InChI=1/C10H19NO3/c1-4-5-6-7(2)9(12)8(11-3)10(13)14/h4-5,7-9,11-12H,6H2,1-3H3,(H,13,14)/b5-4+/t7-,8+,9-/m1/s1
Synonyms:- (4R)-4-[(E)-2-Butenyl]-4,N-dimethyl-L-threonine
- 59865-23-5
- MeBmt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cyclosporin Impurity 4
CAS:Formula:C10H19NO3Color and Shape:White To Off-White SolidMolecular weight:201.274-(2E)-2-Buten-1-yl-2,4,5-trideoxy-2-(methylamino)-L-xylonic Acid
CAS:Controlled ProductFormula:C10H19NO3Color and Shape:NeatMolecular weight:201.263

