CymitQuimica logo

CAS 59875-58-0

:

2-[benzyl(methyl)amino]ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate

Description:
2-[Benzyl(methyl)amino]ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate is a complex organic compound characterized by its multi-functional structure, which includes a pyridine ring substituted with various groups. The presence of the benzyl and methyl amino groups suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. The nitrophenyl group may contribute to its electronic properties, potentially influencing its reactivity and solubility. The dicarboxylate moiety indicates the presence of acidic functional groups, which can participate in various chemical reactions, including esterification and salt formation. This compound may exhibit specific pharmacological activities due to its structural features, and its solubility and stability can be influenced by the substituents on the pyridine ring. Overall, the compound's unique combination of functional groups suggests potential applications in drug development or as a chemical probe in biological studies. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C26H27N3O6
InChI:InChI=1/C26H27N3O6/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19/h5-12,15H,13-14,16H2,1-4H3
SMILES:Cc1c(c(c2cccc(c2)N(=O)=O)c(c(C)n1)C(=O)OCCN(C)Cc1ccccc1)C(=O)OC
Synonyms:
  • 3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-4-(3-nitrophenyl)-, methyl 2-(methyl(phenylmethyl)amino)ethyl ester
  • 2-[Benzyl(methyl)amino]ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.