
CAS 5988-99-8
:Linifolin A
Description:
Linifolin A, with the CAS number 5988-99-8, is a naturally occurring chemical compound classified as a type of alkaloid. It is primarily derived from certain plant species, particularly those in the Linaceae family. This compound is known for its complex structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Linifolin A exhibits a range of pharmacological properties, including potential anti-inflammatory and antimicrobial effects, making it of interest in medicinal chemistry and pharmacology. Its mechanism of action is often linked to its ability to interact with various biological targets, although specific pathways may vary. Additionally, Linifolin A's solubility and stability can be influenced by environmental factors, which are important considerations for its application in research and potential therapeutic uses. As with many natural products, further studies are necessary to fully elucidate its biological effects and potential applications in medicine.
Formula:C17H20O5
InChI:InChI=1S/C17H20O5/c1-8-7-12-14(9(2)16(20)22-12)15(21-10(3)18)17(4)11(8)5-6-13(17)19/h5-6,8,11-12,14-15H,2,7H2,1,3-4H3/t8-,11+,12+,14-,15-,17+/m1/s1
InChI key:InChIKey=DCNRYQODUSSOKC-JKSXDGAISA-N
SMILES:O(C(C)=O)[C@H]1[C@@]2(C)[C@]([C@H](C)C[C@]3([C@]1(C(=C)C(=O)O3)[H])[H])(C=CC2=O)[H]
Synonyms:- Azuleno[6,5-b]furan-2,5-dione, 4-(acetyloxy)-3,3a,4,4a,7a,8,9,9a-octahydro-4a,8-dimethyl-3-methylene-, [3aR-(3aα,4β,4aβ,7aα,8α,9aβ)]-
- (3aR,4R,4aR,7aR,8R,9aS)-4-(Acetyloxy)-3,3a,4,4a,7a,8,9,9a-octahydro-4a,8-dimethyl-3-methyleneazuleno[6,5-b]furan-2,5-dione
- Linifolin A
- Azuleno[6,5-b]furan-2,5-dione, 4-(acetyloxy)-3,3a,4,4a,7a,8,9,9a-octahydro-4a,8-dimethyl-3-methylene-, (3aR,4R,4aR,7aR,8R,9aS)-
- Ambrosa-2,11(13)-dien-12-oic acid, 6β,8α-dihydroxy-4-oxo-, 12,8-lactone, acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Linifolin A
CAS:Linifolin A is a sesquiterpene lactone extracted from Helenium aromaticum.Formula:C17H20O5Color and Shape:SolidMolecular weight:304.34
