CAS 59887-17-1
:B-endorphin bovine
Description:
B-endorphin bovine, with the CAS number 59887-17-1, is a peptide that belongs to the endorphin family, which are endogenous opioid neuropeptides. It is primarily produced in the pituitary gland and plays a crucial role in pain modulation, stress response, and the regulation of mood. B-endorphin is composed of 31 amino acids and is known for its ability to bind to opioid receptors in the brain, leading to analgesic effects and feelings of euphoria. This peptide is highly conserved across species, with bovine B-endorphin being similar to its human counterpart. In terms of physical properties, it is typically a white to off-white powder that is soluble in water, making it suitable for various biochemical applications. B-endorphin's biological activity is significant in research related to pain management, addiction, and mental health disorders. Its stability and efficacy can be influenced by factors such as pH and temperature, which are important considerations in laboratory settings.
Formula:C155H250N42O44S
InChI:InChI=1/C155H250N42O44S/c1-17-82(9)123(150(235)182-99(44-29-34-61-160)134(219)186-109(70-116(164)206)139(224)171-84(11)128(213)183-108(69-92-72-166-78-170-92)144(229)178-96(41-26-31-58-157)132(217)175-95(40-25-30-57-156)131(216)169-75-120(210)173-103(155(240)241)51-54-115(163)205)193-151(236)124(83(10)18-2)192-129(214)85(12)172-140(225)110(71-117(165)207)185-133(218)97(42-27-32-59-158)177-143(228)107(68-90-38-23-20-24-39-90)184-141(226)104(64-79(3)4)188-152(237)126(87(14)201)195-149(234)122(81(7)8)191-145(230)105(65-80(5)6)187-148(233)113-45-35-62-197(113)154(239)127(88(15)202)196-137(222)100(50-53-114(162)204)179-146(231)111(76-198)189-135(220)98(43-28-33-60-159)176-136(221)101(52-55-121(211)212)180-147(232)112(77-199)190-153(238)125(86(13)200)194-138(223)102(56-63-242-16)181-142(227)106(67-89-36-21-19-22-37-89)174-119(209)74-167-118(208)73-168-130(215)94(161)66-91-46-48-93(203)49-47-91/h19-24,36-39,46-49,72,78-88,94-113,122-127,198-203H,17-18,25-35,40-45,50-71,73-77,156-161H2,1-16H3,(H2,162,204)(H2,163,205)(H2,164,206)(H2,165,207)(H,166,170)(H,167,208)(H,168,215)(H,169,216)(H,171,224)(H,172,225)(H,173,210)(H,174,209)(H,175,217)(H,176,221)(H,177,228)(H,178,229)(H,179,231)(H,180,232)(H,181,227)(H,182,235)(H,183,213)(H,184,226)(H,185,218)(H,186,219)(H,187,233)(H,188,237)(H,189,220)(H,190,238)(H,191,230)(H,192,214)(H,193,236)(H,194,223)(H,195,234)(H,196,222)(H,211,212)(H,240,241)/t82-,83-,84-,85-,86+,87+,88+,94-,95-,96-,97-,98-,99-,100-,101-,102-,103-,104-,105-,106-,107-,108-,109-,110-,111-,112-,113-,122-,123-,124-,125-,126-,127-/m0/s1
Synonyms:- beta-Endorphin (1-31)
- beta-Endorphin, triethoxy(3-isothiocyanatopropyl)-, (6R-(6alpha,7alpha,7(R*)))-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
β-Endorphin (rat)
CAS:Beta-endorphin is a basic protein that is an endogenous opioid peptide hormone with potent analgesic effects. Beta-endorphin binds to the kappa-opioid receptor, which inhibits the production of inflammatory cytokines IL-2 and TNF-α in activated macrophages. Beta-endorphin has been shown to have potent inducers of cardiac contractility and vasodilation when administered intravenously to rats. It also binds to the dextran sulfate receptor and can cause vasoconstriction in rat aorta. In addition, beta-endorphin has been shown to be an inhibitor of pluripotent cells, which are cells that have the ability to differentiate into any type of cell. This inhibition may be due to its binding to basic proteins or its effects on the synthesis of peptide hormones such as prolactin or growth hormone.Formula:C157H254N42O44SPurity:Min. 95%Molecular weight:3,466.02 g/molBeta-Endorphin (bovine, camel, mouse)
CAS:<p>Beta-Endorphin (β-EP) is a peptide hormone that has a number of biological properties. It binds to kappa opioid receptors and affects the function of various cells in the body. β-EP is also potent inducers of pluripotent stem cells and has been shown to reduce pain and inflammation, as well as having anti-inflammatory properties. β-EP may also have some physiological effects on the brain, including increasing blood flow to the brain, affecting memory, and reducing stress levels.</p>Formula:C155H250N42O44SPurity:Min. 95%Molecular weight:3,437.97 g/molβ-Endorphin (bovine, camel, mouse)
CAS:<p>Bachem ID: 4007396.</p>Formula:C155H250N42O44SPurity:90.8%Color and Shape:White PowderMolecular weight:3438.01

