CAS 5989-16-2

2,4,6-trihydroxy-2-(4-hydroxybenzyl)-1-benzofuran-3(2H)-one

Description:

2,4,6-Trihydroxy-2-(4-hydroxybenzyl)-1-benzofuran-3(2H)-one, with the CAS number 5989-16-2, is a chemical compound that belongs to the class of flavonoids, specifically a type of benzofuran derivative. This compound is characterized by its multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the benzofuran structure indicates that it may exhibit biological activity, including anti-inflammatory and antimicrobial effects. Its molecular structure features a fused benzofuran ring system, which is known for its stability and ability to participate in various chemical reactions. The hydroxyl groups enhance its solubility in polar solvents and may facilitate interactions with biological macromolecules. Additionally, this compound may be of interest in the field of natural products and medicinal chemistry due to its potential therapeutic applications. Overall, 2,4,6-trihydroxy-2-(4-hydroxybenzyl)-1-benzofuran-3(2H)-one represents a fascinating subject for further research in both synthetic and applied chemistry contexts.

Formula: C₁₅H₁₂O₆

InChI: InChI=1/C15H12O6/c16-9-3-1-8(2-4-9)7-15(20)14(19)13-11(18)5-10(17)6-12(13)21-15/h1-6,16-18,20H,7H2

SMILES: c1cc(ccc1CC1(C(=O)c2c(cc(cc2O1)O)O)O)O

Synonyms:

• 3(2H)-Benzofuranone, 2,4,6-trihydroxy-2-((4-hydroxyphenyl)methyl)-
• 2,4,6-Trihydroxy-2-(4-hydroxybenzyl)-1-benzofuran-3(2H)-one

Maesopsin

CAS: 5989-16-2

Maesopsin analytical standard provided with w/w absolute assay, to be used for quantitative titration.

Formula: C₁₅H₁₂O₆

Purity: (HPLC) ≥98%

Color and Shape: Powder

Molecular weight: 288.26

Ref: 11-0076S

Maesopsin

CAS: 5989-16-2

Formula: C₁₅H₁₂O₆

Molecular weight: 288.25

Ref: 7W-GL3775

Maesopsin

CAS: 5989-16-2

Maesopsin is a flavonoid, which is a type of polyphenolic compound, derived from natural sources such as plants. This compound is primarily found in certain species within the family Fabaceae. Its mode of action involves the scavenging of free radicals, thereby exhibiting significant antioxidant properties. By neutralizing these free radicals, Maesopsin can prevent oxidative stress at the cellular level, which is a key factor in the pathophysiology of various diseases.

Formula: C₁₅H₁₂O₆

Purity: Min. 95%

Molecular weight: 288.25 g/mol

Ref: 3D-FAA98916