CAS 59892-37-4
:5-Nitro-1-(2,3,5-tri-O-benzoyl-β-D-ribofuranosyl)-2(1H)-pyridinone
Description:
5-Nitro-1-(2,3,5-tri-O-benzoyl-β-D-ribofuranosyl)-2(1H)-pyridinone is a complex organic compound characterized by its unique structural features, including a pyridinone ring and a ribofuranosyl moiety that is heavily substituted with benzoyl groups. The presence of the nitro group at the 5-position of the pyridinone contributes to its potential reactivity and biological activity. This compound is typically used in synthetic organic chemistry and may serve as an intermediate in the synthesis of nucleoside analogs or other biologically active molecules. Its solubility properties can vary depending on the solvent, and it may exhibit specific optical activity due to the chiral nature of the ribofuranosyl component. The compound's stability, reactivity, and potential applications in medicinal chemistry make it of interest for further research, particularly in the development of antiviral or anticancer agents. As with many organic compounds, proper handling and storage conditions are essential to maintain its integrity and prevent degradation.
Formula:C31H24N2O10
InChI:InChI=1S/C31H24N2O10/c34-25-17-16-23(33(38)39)18-32(25)28-27(43-31(37)22-14-8-3-9-15-22)26(42-30(36)21-12-6-2-7-13-21)24(41-28)19-40-29(35)20-10-4-1-5-11-20/h1-18,24,26-28H,19H2/t24-,26-,27-,28-/m1/s1
InChI key:InChIKey=IEZNOQUIRFRCMT-YULOIDQLSA-N
SMILES:O(C(=O)C1=CC=CC=C1)[C@H]2[C@@H](O[C@H](COC(=O)C3=CC=CC=C3)[C@H]2OC(=O)C4=CC=CC=C4)N5C=C(N(=O)=O)C=CC5=O
Synonyms:- 2(1H)-Pyridinone, 5-nitro-1-(2,3,5-tri-O-benzoyl-β-D-ribofuranosyl)-
- 5-Nitro-1-(2,3,5-tri-O-benzoyl-β-D-ribofuranosyl)-2(1H)-pyridinone
- 5-Nitro-1-(2,3,5-tri-O-benzoyl-beta-D-ribofuranosyl)-2(1H)-pyridinone
- 1-(2,3,5-Tribenzoyl-O-D-ribofuranosyl)-5-nitropyridine-2(1H)-one
- 1-(2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl)-5-nitropyridine-2(1H)-one
- 1-(2,3,5-Tribenzoyl--D-ribofuranosyl)-5-nitropyridine-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2,3,5-Tribenzoyl-b-D-ribofuranosyl)-5-nitropyridine-2(1H)-one
CAS:<p>1-(2,3,5-Tribenzoyl-b-D-ribofuranosyl)-5-nitropyridine-2(1H)-one is a Pyrimidine nucleoside.</p>Formula:C31H24N2O10Color and Shape:SolidMolecular weight:584.53
