CAS 59892-40-9

4-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3H-triazolo[4,5-b]pyridin-5-one

Description:

The chemical substance known as "4-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3H-triazolo[4,5-b]pyridin-5-one," with the CAS number 59892-40-9, is a complex organic compound featuring a triazolo-pyridine core and a sugar-like moiety. This compound exhibits several notable characteristics, including the presence of multiple hydroxyl groups, which contribute to its potential solubility in polar solvents and may enhance its biological activity. The stereochemistry indicated by the (2R,4R,5R) configuration suggests specific spatial arrangements that could influence its interactions with biological targets. The triazolo and pyridine rings may impart unique electronic properties, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's structural features suggest potential for hydrogen bonding and interactions with enzymes or receptors, which could be relevant in drug design and development. Overall, this compound represents a fascinating intersection of carbohydrate chemistry and heterocyclic chemistry, with implications for therapeutic use.

Formula: C₁₀H₁₂N₄O₅

InChI: InChI=1/C10H12N4O5/c15-3-5-7(17)8(18)10(19-5)14-6(16)2-1-4-9(14)12-13-11-4/h1-2,5,7-8,10,15,17-18H,3H2,(H,11,12,13)/t5-,7+,8?,10-/m1/s1

4-(b-D-Ribofuranosyl)-vic-triazolo[4,5-b]pyridin-5-one

CAS: 59892-40-9

Ref: 7W-GC2907

4-(b-D-Ribofuranosyl)-vic-triazolo[4,5-b]pyridin-5-one

CAS: 59892-40-9

Ribonucleosides, Deoxyribonucleosides and Activator are a group of synthetic compounds that are used in the synthesis of DNA. Ribonucleosides and Deoxyribonucleosides are nucleotides that contain ribose or deoxyribose as the sugar moiety. Activator is an activator for DNA polymerase, which catalyses the formation of a phosphodiester bond between two adjacent 3'-5' phosphate groups on a single strand of DNA. Ribonuclesides, Deoxyribonucleosides and Activator are used in recombinant DNA technology to synthesize DNA molecules containing modified bases. The CAS number for Ribonuclesides, Deoxyribonucleosides and Activator is 59892-40-9.

Formula: C₁₀H₁₂N₄O₅

Purity: Min. 95%

Molecular weight: 268.23 g/mol

Ref: 3D-NR04971

4-(β-D-Ribofuranosyl)-vic-triazolo[4,5-b]pyridin-5-one

Controlled Product

CAS: 59892-40-9

Formula: C₁₀H₁₂N₄O₅

Color and Shape: Neat

Molecular weight: 268.23

Ref: TR-R415750