CAS 59898-59-8

3,5,6-trimethyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one

Description:

3,5,6-trimethyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its unique thieno-pyrimidine structure, which incorporates both sulfur and nitrogen atoms. This compound features a thioxo group, contributing to its reactivity and potential biological activity. The presence of three methyl groups at positions 3, 5, and 6 enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The thieno[2,3-d]pyrimidine framework is known for its diverse pharmacological properties, making this compound of interest in medicinal chemistry. Its CAS number, 59898-59-8, allows for easy identification in chemical databases. The compound may exhibit various properties such as antimicrobial, antiviral, or anticancer activities, although specific biological data would be necessary to confirm these effects. Overall, the structural features of 3,5,6-trimethyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one suggest potential utility in drug development and research.

Formula: C₉H₁₀N₂OS₂

InChI: InChI=1/C9H10N2OS2/c1-4-5(2)14-7-6(4)8(12)11(3)9(13)10-7/h1-3H3,(H,10,13)

SMILES: Cc1c(C)sc2c1c(=O)n(C)c(n2)S

Synonyms:

• Thieno[2,3-d]pyrimidin-4(1H)-one, 2,3-dihydro-3,5,6-trimethyl-2-thioxo-
• thieno[2,3-d]pyrimidin-4(3H)-one, 2-mercapto-3,5,6-trimethyl-
• 3,5,6-Trimethyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one

2-MERCAPTO-3,5,6-TRIMETHYLTHIENO[2,3-D]PYRIMIDIN-4(3H)-ONE

CAS: 59898-59-8

Formula: C₉H₁₀N₂OS₂

Purity: 95%

Molecular weight: 226.3185

Ref: IN-DA00ECJQ

2-mercapto-3,5,6-trimethylthieno[2,3-d]pyrimidin-4(3H)-one

CAS: 59898-59-8

Formula: C₉H₁₀N₂OS₂

Molecular weight: 226.31

Ref: 10-F346540