CAS 59899-91-1

5-Chloro-1,2-benzisoxazole-3-acetic acid

Description:

5-Chloro-1,2-benzisoxazole-3-acetic acid is a chemical compound characterized by its unique structure, which includes a benzisoxazole ring and an acetic acid functional group. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chlorine atom in the benzisoxazole ring can influence its biological activity and solubility. The compound is often utilized in research for its ability to interact with various biological targets, making it of interest in the study of drug design and development. Its molecular structure contributes to its reactivity and stability under certain conditions, and it may exhibit specific properties such as acidity due to the carboxylic acid group. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken. Overall, 5-Chloro-1,2-benzisoxazole-3-acetic acid represents a significant compound in the field of organic chemistry and pharmacology.

Formula: C₉H₆ClNO₃

InChI: InChI=1S/C9H6ClNO3/c10-5-1-2-8-6(3-5)7(11-14-8)4-9(12)13/h1-3H,4H2,(H,12,13)

InChI key: InChIKey=SOEYFTOJPIHAOD-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=2C(ON1)=CC=C(Cl)C2

Synonyms:

• 2-(5-Chloro-1,2-benzoxazol-3-yl)acetic acid
• 1,2-Benzisoxazole-3-acetic acid, 5-chloro-
• 2-(5-Chlorobenzo[d]isoxazol-3-yl)acetic acid
• 5-Chloro-1,2-benzisoxazole-3-acetic acid

2-(5-chlorobenzo[d]isoxazol-3-yl)acetic acid

CAS: 59899-91-1

Formula: C₉H₆ClNO₃

Purity: 95.0%

Molecular weight: 211.6

Ref: 10-F521031