CAS 599-07-5
:Medicagenic acid
Description:
Medicagenic acid, with the CAS number 599-07-5, is a triterpenoid compound primarily derived from the seeds of the plant species *Medicago sativa*, commonly known as alfalfa. This compound is characterized by its pentacyclic structure, which is typical of many triterpenoids, and it exhibits a variety of biological activities. Medicagenic acid is known for its potential anti-inflammatory, antioxidant, and hepatoprotective properties, making it of interest in pharmacological research. It is also studied for its role in modulating lipid metabolism and its potential effects on cholesterol levels. The compound is typically found in the form of a white to off-white crystalline powder and is soluble in organic solvents. Its chemical structure allows for various modifications, which can lead to derivatives with enhanced biological activity. Overall, medicagenic acid represents a significant area of interest in natural product chemistry and its applications in health and medicine.
Formula:C30H46O6
InChI:InChI=1S/C30H46O6/c1-25(2)11-13-30(24(35)36)14-12-27(4)17(18(30)15-25)7-8-20-26(3)16-19(31)22(32)29(6,23(33)34)21(26)9-10-28(20,27)5/h7,18-22,31-32H,8-16H2,1-6H3,(H,33,34)(H,35,36)/t18-,19-,20+,21+,22-,26+,27+,28+,29-,30-/m0/s1
InChI key:InChIKey=IDGXIXSKISLYAC-WNTKNEGGSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@@](C(O)=O)(C)[C@@H](O)[C@@H](O)C3)[H])(CC=C4[C@@]2(C)CC[C@]5(C(O)=O)[C@]4(CC(C)(C)CC5)[H])[H]
Synonyms:- (2β,3β,4α)-2,3-Dihydroxyolean-12-ene-23,28-dioic acid
- 2β,3β-Dihydroxyolean-12-en-23,28-dioic acid
- Castanogenin
- Medicagenic acid
- Medicogenic acid
- NSC 382024
- Olean-12-Ene-23,28-Dioic Acid, 2,3-Dihydroxy-, (2Beta,3Beta)-
- Olean-12-ene-23,28-dioic acid, 2,3-dihydroxy-, (2β,3β,4α)-
- Olean-12-ene-23,28-dioic acid, 2β,3β-dihydroxy-
- (2beta,3beta)-2,3-Dihydroxyolean-12-ene-23,28-dioic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Medicagenic acid
CAS:Medicagenic acid analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C30H46O6Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:502.69Medicagenic acid
CAS:Medicagenic acid, the factor responsible for hemolytic activity of lucerne saponins.Medicagenic acid derivatives exhibit potent fungistatic effects against several plant pathogens and human dermatophytes.Formula:C30H46O6Purity:95%~99%Molecular weight:502.692medicagenic acid
CAS:<p>Medicagenic acid (Castanogenin), isolated from Herniaria glabra L, exhibits potent fungistatic effects against several plant pathogens and human dermatophytes.</p>Formula:C30H46O6Purity:99.53% - 99.84%Color and Shape:SolidMolecular weight:502.68Medicagenic acid
CAS:Carboxylic acid with alcohol functionFormula:C30H46O6Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:502.69Medicagenic Acid
CAS:Controlled Product<p>Applications Medicagenic acid is a versatile compound extracted from some plants, such as the branches of Eucommia ulmoides. It has antifungal properties towards candida albicans.<br>References Xiong, W.; et al.: Chem. Nat. Compd., 54, 1009 (2018); Dorsaz, S.; et al.: Antimicrob. Agents Chemother., 61, 00829-17/1 (2017).<br></p>Formula:C30H46O6Color and Shape:White To Off-WhiteMolecular weight:502.68Medicagenic acid
CAS:Controlled Product<p>Medicagenic acid is a triterpenoid saponin, which is a naturally occurring compound derived from the plant *Medicago sativa*, commonly known as alfalfa. This compound is isolated as a part of the plant’s complex secondary metabolite profile. The mode of action of medicagenic acid involves various biological interactions, including membrane permeation and modulation of cellular pathways, attributed to its amphiphilic nature. It interacts with biomembranes, potentially disrupting lipid bilayers, which can affect cell function and integrity.</p>Formula:C30H46O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:502.68 g/mol
