CAS 59926-78-2
:[(4R)-4-[(D-alanyl-3-thioxo-D-alanyl-L-valyl)amino]-5-{[(2S)-4-methyl-1-oxo-1-sulfanylpentan-2-yl]amino}-5-oxopentan-2-ylidene]methane
Description:
The chemical substance with the name "[(4R)-4-[(D-alanyl-3-thioxo-D-alanyl-L-valyl)amino]-5-{[(2S)-4-methyl-1-oxo-1-sulfanylpentan-2-yl]amino}-5-oxopentan-2-ylidene]methane" and CAS number "59926-78-2" is a complex organic compound characterized by its intricate structure, which includes multiple amino acid residues and functional groups. This compound features a thioxo group, indicating the presence of sulfur, which can influence its reactivity and biological activity. The presence of both D- and L-amino acids suggests potential applications in peptide synthesis or as a bioactive molecule, possibly in pharmaceuticals or biochemistry. The oxo and thioxo functionalities may contribute to its potential as a ligand or in enzyme interactions. Additionally, the stereochemistry indicated by the R and S designations suggests that the compound may exhibit specific spatial configurations that could affect its interactions in biological systems. Overall, this compound's unique structural features may provide insights into its potential applications in medicinal chemistry or as a research tool in biochemical studies.
Formula:C23H39N5O5S2
InChI:InChI=1/C23H39N5O5S2/c1-11(2)8-15(20(30)26-16(23(33)35)9-12(3)4)25-22(32)18(13(5)6)28-21(31)17(10-34)27-19(29)14(7)24/h10,12-18H,1,8-9,24H2,2-7H3,(H,25,32)(H,26,30)(H,27,29)(H,28,31)(H,33,35)/t14-,15-,16+,17-,18+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Malformin C
CAS:Malformin C, a fungus peptide, fights Bacillus and changes human leukemia cell cycles; less effective in cancer xenografts.Formula:C23H39N5O5S2Color and Shape:SolidMolecular weight:529.72Malformin C
CAS:Malformin C is a cyclic pentapeptide, which is a secondary metabolite derived from certain strains of the fungus Aspergillus. Its mode of action involves disrupting cellular processes by interfering with cell division. Specifically, it is thought to affect mitotic spindle formation, leading to abnormal cell cycle progression.
Formula:C23H39N5O5S2Purity:Min. 95%Color and Shape:PowderMolecular weight:529.72 g/molRef: 3D-JCA92678
Discontinued product



