
CAS 59939-16-1
:Cirazoline
Description:
Cirazoline is a chemical compound classified as a selective alpha-1 adrenergic agonist, primarily used in the field of pharmacology. It is known for its vasoconstrictive properties, which make it useful in various medical applications, particularly in the treatment of hypotension and as a nasal decongestant. Cirazoline acts by stimulating alpha-1 adrenergic receptors, leading to smooth muscle contraction and increased vascular resistance. The compound is typically administered in specific formulations to ensure controlled dosage and efficacy. Its chemical structure includes a piperazine ring, which contributes to its pharmacological activity. Cirazoline is also studied for its potential effects on the central nervous system, although its primary applications remain in cardiovascular and respiratory treatments. As with many adrenergic agents, caution is advised regarding its use, as it may lead to side effects such as hypertension or tachycardia. Overall, Cirazoline exemplifies the intricate relationship between chemical structure and biological activity in medicinal chemistry.
Formula:C13H16N2O
InChI:InChI=1S/C13H16N2O/c1-2-4-12(11(3-1)10-5-6-10)16-9-13-14-7-8-15-13/h1-4,10H,5-9H2,(H,14,15)
InChI key:InChIKey=YAORIDZYZDUZCM-UHFFFAOYSA-N
SMILES:O(CC=1NCCN1)C2=C(C=CC=C2)C3CC3
Synonyms:- 2-[(2-Cyclopropylphenoxy)methyl]-4,5-dihydro-1H-imidazole
- Cirazoline
- 1H-Imidazole, 2-[(2-cyclopropylphenoxy)methyl]-4,5-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cirazoline (free base)
CAS:Cirazoline: full α1A agonist, partial α1B/D, nonselective α2 antagonist; potential vasoconstrictor.Formula:C13H16N2OColor and Shape:SolidMolecular weight:216.28
