CymitQuimica logo

CAS 59944-75-1

:

thieno[2,3-b]pyrazin-7-amine

Description:
Thieno[2,3-b]pyrazin-7-amine is a heterocyclic organic compound characterized by its fused thieno and pyrazine rings, which contribute to its unique chemical properties. This compound features an amino group (-NH2) at the 7-position of the pyrazine ring, enhancing its reactivity and potential for forming hydrogen bonds. Thieno[2,3-b]pyrazin-7-amine is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the presence of the amino group. Its structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity against certain targets. The compound's electronic properties, influenced by the conjugated system of the thieno and pyrazine moieties, can also play a role in its interactions with biological systems. Overall, thieno[2,3-b]pyrazin-7-amine is of interest for its potential applications in drug discovery and material science, owing to its unique structural features and reactivity.
Formula:C6H5N3S
InChI:InChI=1S/C6H5N3S/c7-4-3-10-6-5(4)8-1-2-9-6/h1-3H,7H2
InChI key:InChIKey=ZRVKSPNBHZCQKY-UHFFFAOYSA-N
SMILES:c1cnc2c(c(cs2)N)n1
Found 4 products.