CAS 59944-76-2
:Thieno[2,3-b]pyridine-2-carboxylic acid
Description:
Thieno[2,3-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its acidity and making it a potential candidate for various chemical reactions, including esterification and amidation. The presence of the thieno and pyridine moieties imparts significant biological activity, often making such compounds of interest in medicinal chemistry for their potential pharmacological properties. Thieno[2,3-b]pyridine derivatives are known for their roles in drug development, particularly in targeting specific biological pathways. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure allows for various substitution patterns, which can influence its reactivity and interaction with biological targets. Overall, Thieno[2,3-b]pyridine-2-carboxylic acid represents a versatile scaffold in organic synthesis and medicinal chemistry, with ongoing research into its applications and derivatives.
Formula:C8H5NO2S
InChI:InChI=1S/C8H5NO2S/c10-8(11)6-4-5-2-1-3-9-7(5)12-6/h1-4H,(H,10,11)
InChI key:InChIKey=XGCSHAYMNOFFNA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(S1)=NC=CC2
Synonyms:- Thieno[2,3-b]pyridine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Thieno[2,3-b]pyridine-2-carboxylic acid
CAS:Formula:C8H5NO2SPurity:97%Color and Shape:SolidMolecular weight:179.1958Thieno[2,3-b]pyridine-2-carboxylic acid
CAS:Thieno[2,3-b]pyridine-2-carboxylic acidFormula:C8H5NO2SPurity:≥95%Color and Shape: faint to light beige solidMolecular weight:179.20g/molTHIENO[2,3-B]PYRIDINE-2-CARBOXYLIC ACID
CAS:Formula:C8H5NO2SPurity:97%Color and Shape:SolidMolecular weight:179.19Thieno[2,3-b]pyridine-2-carboxylic acid
CAS:Thieno[2,3-b]pyridine-2-carboxylic acid is a carboxylic acid that is used as an additive in foods. It has an appealing taste and can be used to enhance the flavor of food products. Thieno[2,3-b]pyridine-2-carboxylic acid is also used as an antiinflammatory agent for inflammatory diseases such as rheumatoid arthritis and asthma. This compound has been shown to inhibit cycloadditions with amines and carbonaceous compounds. Research on this compound has also found that it may have anticancer activity by inhibiting the IκB kinase.
Formula:C8H5NO2SPurity:Min. 95%Molecular weight:179.2 g/mol



