CymitQuimica logo

CAS 59946-73-5

:

2-(2-Pyridinyl)ethyl 4-(2-chlorophenyl)-1,4-dihydro-2,6-dimethyl-5-[(phenylamino)carbonyl]-3-pyridinecarboxylate

Description:
2-(2-Pyridinyl)ethyl 4-(2-chlorophenyl)-1,4-dihydro-2,6-dimethyl-5-[(phenylamino)carbonyl]-3-pyridinecarboxylate, with the CAS number 59946-73-5, is a complex organic compound characterized by its multi-functional structure. It features a pyridine ring, which is known for its aromatic properties and ability to participate in various chemical reactions. The presence of a chlorophenyl group introduces halogen functionality, which can influence the compound's reactivity and biological activity. The dihydropyridine moiety suggests potential applications in medicinal chemistry, particularly in the development of calcium channel blockers or other pharmacological agents. Additionally, the phenylamino and carbonyl groups may contribute to the compound's ability to form hydrogen bonds, enhancing its interactions with biological targets. Overall, this compound's intricate structure and diverse functional groups make it a subject of interest for research in organic synthesis and medicinal chemistry, potentially leading to novel therapeutic applications.
Formula:C28H26ClN3O3
InChI:InChI=1S/C28H26ClN3O3/c1-18-24(27(33)32-21-11-4-3-5-12-21)26(22-13-6-7-14-23(22)29)25(19(2)31-18)28(34)35-17-15-20-10-8-9-16-30-20/h3-14,16,26,31H,15,17H2,1-2H3,(H,32,33)
InChI key:InChIKey=YGKDFWHVQNDMLG-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C=2C(C(C(OCCC3=CC=CC=N3)=O)=C(C)NC2C)C4=C(Cl)C=CC=C4
Synonyms:
  • 3-Pyridinecarboxylic acid, 4-(2-chlorophenyl)-1,4-dihydro-2,6-dimethyl-5-[(phenylamino)carbonyl]-, 2-(2-pyridinyl)ethyl ester
  • 2-(2-Pyridinyl)ethyl 4-(2-chlorophenyl)-1,4-dihydro-2,6-dimethyl-5-[(phenylamino)carbonyl]-3-pyridinecarboxylate
  • YC 170
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.