CAS 59952-97-5

Carlinoside

Description:

Carlinoside, with the CAS number 59952-97-5, is a naturally occurring glycoside primarily derived from the plant species Carlinia species, particularly Carlinia inequalis. This compound is characterized by its unique structure, which typically includes a sugar moiety linked to an aglycone, contributing to its biological activity. Carlinoside has garnered interest in pharmacological research due to its potential therapeutic properties, including anti-inflammatory and antioxidant effects. It is often studied for its role in traditional medicine and its possible applications in modern pharmacotherapy. The compound is soluble in polar solvents, which facilitates its extraction from plant materials. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As research continues, the full spectrum of its biological activities and mechanisms of action is being explored, highlighting the importance of natural products in drug discovery and development.

Formula: C₂₆H₂₈O₁₅

InChI: InChI=1S/C26H28O15/c27-5-13-18(33)21(36)23(38)26(41-13)15-19(34)14-10(30)4-12(7-1-2-8(28)9(29)3-7)40-24(14)16(20(15)35)25-22(37)17(32)11(31)6-39-25/h1-4,11,13,17-18,21-23,25-29,31-38H,5-6H2/t11-,13+,17-,18+,21-,22+,23+,25-,26-/m0/s1

InChI key: InChIKey=XBGYTZHKGMCEGE-VYUBKLCTSA-N

SMILES: OC=1C(=C2C(=C(O)C1[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C(=O)C=C(O2)C4=CC(O)=C(O)C=C4)[C@H]5[C@H](O)[C@@H](O)[C@@H](O)CO5

Synonyms:

• 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]-8-[(2S,3R,4S,5S)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl]-4H-chromen-4-one (non-preferred name)
• Lucenin 5
• Luteolin 6-C-β-D-glucopyranoside-8-C-α-L-arabinopyranoside
• Carlinoside
• 4H-1-Benzopyran-4-one, 8-α-L-arabinopyranosyl-2-(3,4-dihydroxyphenyl)-6-β-D-glucopyranosyl-5,7-dihydroxy-
• 8-α-L-Arabinopyranosyl-2-(3,4-dihydroxyphenyl)-6-β-D-glucopyranosyl-5,7-dihydroxy-4H-1-benzopyran-4-one

Carlinoside

CAS: 59952-97-5

Formula: C₂₆H₂₈O₁₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 580.495

Ref: BP-BP1848

Carlinoside

CAS: 59952-97-5

Carlinoside could be a worthy choice to intervene hyperbilirubinemia due to liver dysfunction.

Formula: C₂₆H₂₈O₁₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 580.49

Ref: TM-TMA0237

Carlinoside

CAS: 59952-97-5

Carlinoside is a bioactive flavonoid glycoside, which is typically sourced from plants of the Astraceae family, specifically from the genus Carlina. As a natural phytochemical, its mode of action involves the modulation of various biochemical pathways, primarily through its antioxidant properties and potential to interact with cellular oxidative stress mechanisms.

Formula: C₂₆H₂₈O₁₆

Purity: Min. 95%

Molecular weight: 596.49 g/mol

Ref: 3D-FC157179