CAS 59957-75-4

2,2'-diselane-1,2-diyldipyridine

Description:

2,2'-Diselane-1,2-diyldipyridine, with the CAS number 59957-75-4, is an organosilicon compound characterized by the presence of two silane groups connected by a dipyridine moiety. This compound typically exhibits properties associated with both silanes and pyridine derivatives, including potential reactivity due to the presence of silicon-silicon bonds and nitrogen-containing heterocycles. The silane groups can participate in various chemical reactions, such as hydrolysis and condensation, making this compound of interest in materials science and organic synthesis. The dipyridine structure may contribute to its ability to coordinate with metal ions, enhancing its utility in catalysis or as a ligand in coordination chemistry. Additionally, the presence of nitrogen atoms in the pyridine rings can influence the compound's electronic properties and solubility in different solvents. Overall, 2,2'-diselane-1,2-diyldipyridine is a versatile compound with potential applications in various fields, including organic synthesis, materials science, and coordination chemistry.

Formula: C₁₀H₈N₂Se₂

InChI: InChI=1/C10H8N2Se2/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10/h1-8H

SMILES: c1ccnc(c1)[Se][Se]c1ccccn1

Synonyms:

• Pyridine, 2,2'-diselenobis-

2,2'-Dipyridyl diselenide

CAS: 59957-75-4

2,2'-dipyridyl diselenide is a chemical compound with the formula (CH)SeS. It is an organoselenium compound with a disulfide bond, which is a functional group consisting of two sulfur atoms bridged by two carbon atoms. 2,2'-Dipyridyl diselenide has been used to study the mechanism of cancer cell locomotion. This chemical can be prepared as an organic solution in trifluoroacetic acid and minimal toxicity was observed when it was tested on mice. FT-IR spectroscopy confirmed that this chemical has an amido group and a phosphite group. The structure of this chemical was determined by xerography and x-ray crystallography experiments, revealing that it is a polymeric material that contains hydroxyl groups and polycarboxylic acid groups.

Formula: C₁₀H₈N₂Se₂

Purity: Min. 95%

Color and Shape: Red Powder

Molecular weight: 314.1 g/mol

Ref: 3D-FD11023