CAS 59961-15-8

Methyl 3-(bromomethyl)thiophene-2-carboxylate

Description:

Methyl 3-(bromomethyl)thiophene-2-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromomethyl group indicates that there is a bromine atom attached to a carbon chain, which can enhance the compound's reactivity, particularly in nucleophilic substitution reactions. The carboxylate group, derived from a carboxylic acid, contributes to the compound's polar nature and solubility in polar solvents. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its functional groups that allow for further chemical modifications. Its molecular structure suggests potential applications in materials science and as an intermediate in various chemical reactions. Safety data should be consulted, as halogenated compounds can pose health risks, and proper handling and disposal procedures should be followed. Overall, Methyl 3-(bromomethyl)thiophene-2-carboxylate is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₇H₇BrO₂S

InChI: InChI=1/C7H7BrO2S/c1-10-7(9)6-5(4-8)2-3-11-6/h2-3H,4H2,1H3

SMILES: COC(=O)c1c(ccs1)CBr

Synonyms:

• 2-Thiophenecarboxylic acid, 3-(bromomethyl)-, methyl ester

Methyl 3-(bromomethyl)thiophene-2-carboxylate

CAS: 59961-15-8

Methyl 3-(bromomethyl)thiophene-2-carboxylate

Purity: 97%

Molecular weight: 235.1g/mol

Ref: 54-OR1057049

3-Bromomethyl-thiophene-2-carboxylic acid methyl ester

CAS: 59961-15-8

Purity: 97.0%

Color and Shape: Solid, Light yellow solid

Molecular weight: 235.10000610351562

Ref: 10-F040831

Methyl 3-(bromomethyl)thiophene-2-carboxylate

CAS: 59961-15-8

Methyl 3-(bromomethyl)thiophene-2-carboxylate belongs to the group of carboxylic compounds. It has a basic hydrolysis reaction and is an intramolecular cyclization. The compound is made up of two isomers, 3-bromomethylthiophene-2-carboxylic acid and 2-bromomethylthiophene-3-carboxylic acid. The two isomers are analogous to each other in terms of the reactions they undergo. Methyl 3-(bromomethyl)thiophene-2-carboxylate can be used as a precursor for various pharmaceuticals, including 5 alpha reductase inhibitors and immunosuppressants.

Formula: C₇H₇BrO₂S

Purity: Min. 95%

Molecular weight: 235.1 g/mol

Ref: 3D-JCA96115