CAS 59962-54-8
:1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-(hydroxymethyl)-1-methylurea
Description:
1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-(hydroxymethyl)-1-methylurea, with CAS number 59962-54-8, is a chemical compound characterized by its unique structural features, including a thiadiazole ring and a urea functional group. The presence of the tert-butyl group enhances its hydrophobic properties, potentially influencing its solubility and biological activity. The hydroxymethyl group contributes to its reactivity and may facilitate interactions with biological targets. This compound is often studied for its potential applications in agricultural chemistry, particularly as a herbicide or plant growth regulator, due to its ability to affect plant metabolism. Its molecular structure suggests it may exhibit specific binding affinities, making it of interest in medicinal chemistry as well. Additionally, the thiadiazole moiety is known for its diverse biological activities, including antimicrobial and antifungal properties. Overall, this compound represents a class of chemicals that bridge the fields of organic synthesis and agricultural science, with ongoing research aimed at elucidating its full range of properties and applications.
Formula:C9H16N4O2S
InChI:InChI=1/C9H16N4O2S/c1-9(2,3)6-11-12-8(16-6)13(4)7(15)10-5-14/h14H,5H2,1-4H3,(H,10,15)
SMILES:CC(C)(C)c1nnc(N(C)C(=NCO)O)s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Desmethyl-N-hydroxymethyl Tebuthiuron
CAS:Controlled ProductFormula:C9H16N4O2SColor and Shape:White To Off-WhiteMolecular weight:244.31Tebuthiuron-N-hydroxymethyl
CAS:Tebuthiuron-N-hydroxymethyl is a derivative herbicide, primarily sourced from synthetic chemical processes. It functions as a broad-spectrum soil-active herbicide with systemic properties. Its mode of action involves the inhibition of photosynthesis by disrupting electron transport in the chloroplasts, thereby stunting plant growth and effectively controlling a wide range of vegetation.Formula:C9H16N4O2SPurity:Min. 95%Molecular weight:244.32 g/mol


