CAS 59979-57-6
:Tagitinin F
Description:
Tagitinin F is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant species *Tagetes erecta*, commonly known as marigold. This compound is characterized by its complex bicyclic structure, which contributes to its biological activity. Tagitinin F exhibits notable anti-inflammatory and antimicrobial properties, making it of interest in pharmacological research. Its mechanism of action often involves the modulation of various signaling pathways, which can influence cellular responses. Additionally, Tagitinin F has been studied for its potential applications in agriculture as a natural pesticide due to its ability to deter pests. The compound is typically isolated through extraction and purification processes, and its stability can be affected by environmental factors such as light and temperature. As with many natural products, further research is ongoing to fully elucidate its mechanisms of action and potential therapeutic applications.
Formula:C19H24O6
InChI:InChI=1S/C19H24O6/c1-10(2)16(20)24-14-9-18(5)6-7-19(22,25-18)11(3)8-13-15(14)12(4)17(21)23-13/h6-8,10,13-15,22H,4,9H2,1-3,5H3/b11-8-/t13-,14-,15+,18+,19-/m1/s1
InChI key:InChIKey=XJUPOHKZSDZNBE-QDHYIOMWSA-N
SMILES:O(C(C(C)C)=O)[C@H]1[C@@]2([C@@](/C=C(/C)\[C@]3(O)O[C@](C)(C1)C=C3)(OC(=O)C2=C)[H])[H]
Synonyms:- (10E)-9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-2,3,3a,4,5,6,9,11a-octahydro-6,9-epoxycyclodeca[b]furan-4-yl 2-methylpropanoate
- 6,9-Epoxycyclodeca[b]furan, propanoic acid deriv.
- NSC 291860
- Propanoic acid, 2-methyl-, (3aR,4R,6R,9R,10Z,11aR)-2,3,3a,4,5,6,9,11a-octahydro-9-hydroxy-6,10-dimethyl-3-methylene-2-oxo-6,9-epoxycyclodeca[b]furan-4-yl ester
- Propanoic acid, 2-methyl-, 2,3,3a,4,5,6,9,11a-octahydro-9-hydroxy-6,9-dimethyl-3-methylene-2-oxo-6,9-epoxycyclodeca[b]furan-4-yl ester, [3aR-(3aR*,4R*,6R*,9R*,10Z,11aR*)]-
- Tagitinin F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tagitinin F
CAS:Tagitinin F possesses antileukemic activity; it also shows in vitro leishmanicidal activities against Leishmania braziliensis promastigotes and amastigotes.Formula:C19H24O6Purity:98%Color and Shape:SolidMolecular weight:348.39Tagitinin F
CAS:Tagitinin F is a sesquiterpene lactone, which is an organic compound derived from the aerial parts of the plant *Tithonia diversifolia*, commonly known as the Mexican sunflower. This plant-based compound functions through a mechanism that involves modulation of various cellular pathways, notably those related to inflammation and cancer progression, by interacting with cellular proteins and inhibiting key signaling molecules.
Purity:Min. 95%Ref: 3D-FT42601
Discontinued product


