CAS 59979-61-2

Tagitinin A

Description:

Tagitinin A is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant species *Tagetes erecta*, commonly known as marigold. This compound is characterized by its complex bicyclic structure, which contributes to its biological activity. Tagitinin A exhibits notable anti-inflammatory and cytotoxic properties, making it of interest in pharmacological research. Its mechanism of action often involves the modulation of various signaling pathways, which can influence cell proliferation and apoptosis. Additionally, Tagitinin A has been studied for its potential use in cancer therapy and as an insect repellent. The compound is typically characterized by its solubility in organic solvents and its relatively low solubility in water, which is common for many sesquiterpene lactones. As with many natural products, the extraction and purification processes can significantly affect the yield and purity of Tagitinin A, making it essential for researchers to optimize these methods for effective study and application.

Formula: C₁₉H₂₈O₇

InChI: InChI=1S/C19H28O7/c1-9(2)16(21)25-13-7-18(5)14(20)8-19(23,26-18)10(3)6-12-15(13)11(4)17(22)24-12/h9-10,12-15,20,23H,4,6-8H2,1-3,5H3/t10-,12+,13+,14+,15-,18+,19-/m0/s1

InChI key: InChIKey=HREHFPZHVCNOMQ-YCIRREICSA-N

SMILES: O(C(C(C)C)=O)[C@H]1[C@@]2([C@@](C[C@H](C)[C@@]3(O)O[C@](C)(C1)[C@H](O)C3)(OC(=O)C2=C)[H])[H]

Synonyms:

• Tagitinin A
• 6,9-Epoxycyclodeca[b]furan, propanoic acid deriv.
• Propanoic acid, 2-methyl-, (3aS,4R,6R,7R,9S,10S,11aR)-dodecahydro-7,9-dihydroxy-6,10-dimethyl-3-methylene-2-oxo-6,9-epoxycyclodeca[b]furan-4-yl ester

Tagitinin A

CAS: 59979-61-2

Tagitinin A， a natural sesquiterpene lactone ，a dual agonist of PPARα/PPARγ，exerts antihyperglycemic and antihyperlipidemic effects in diabetes research.

Formula: C₁₉H₂₈O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 368.42

Ref: TM-TN5091

Tagitinin A

CAS: 59979-61-2

Formula: C₁₉H₂₈O₇

Purity: 95%~99%

Color and Shape: Cryst.

Molecular weight: 368.426

Ref: BP-SBP00186

Tagitinin A

CAS: 59979-61-2

Tagitinin A is a naturally occurring sesquiterpene lactone, which is derived from the plant *Tithonia diversifolia*. This compound is known for its potential therapeutic properties, particularly in the field of oncology. As a sesquiterpene lactone, Tagitinin A is part of a larger class of secondary metabolites found in various plant species, which often exhibit diverse biological activities.

Purity: Min. 95%

Ref: 3D-FT42602