CAS 59985-23-8

3-[[2-(Acetylamino)-2-deoxy-β-D-galactopyranosyl]oxy]-7-bromo-N-(2-methoxyphenyl)-2-naphthalenecarboxamide

Description:

The chemical substance known as "3-[[2-(Acetylamino)-2-deoxy-β-D-galactopyranosyl]oxy]-7-bromo-N-(2-methoxyphenyl)-2-naphthalenecarboxamide," with the CAS number 59985-23-8, is a complex organic compound characterized by its structural components, which include a naphthalene backbone, a bromine atom, and a sugar moiety derived from galactose. This compound features an acetylamino group and a methoxyphenyl substituent, contributing to its potential biological activity. The presence of the β-D-galactopyranosyl unit suggests that it may interact with biological systems, possibly influencing glycosylation processes or serving as a substrate for specific enzymes. Its unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity would depend on its functional groups and overall molecular architecture, which could influence its applications in research or therapeutic contexts. Further studies would be necessary to elucidate its precise biological effects and potential uses.

Formula: C₂₆H₂₇BrN₂O₈

InChI: InChI=1S/C26H27BrN2O8/c1-13(31)28-22-24(33)23(32)21(12-30)37-26(22)36-20-11-14-7-8-16(27)9-15(14)10-17(20)25(34)29-18-5-3-4-6-19(18)35-2/h3-11,21-24,26,30,32-33H,12H2,1-2H3,(H,28,31)(H,29,34)/t21-,22-,23+,24-,26-/m1/s1

InChI key: InChIKey=DMLKUPXKUQREOC-HROMDODWSA-N

SMILES: C(NC1=C(OC)C=CC=C1)(=O)C=2C(O[C@H]3[C@H](NC(C)=O)[C@@H](O)[C@@H](O)[C@@H](CO)O3)=CC4=C(C2)C=C(Br)C=C4

Synonyms:

• 2-Naphthalenecarboxamide, 3-[[2-(acetylamino)-2-deoxy-β-D-galactopyranosyl]oxy]-7-bromo-N-(2-methoxyphenyl)-
• 3-[[2-(Acetylamino)-2-deoxy-β-D-galactopyranosyl]oxy]-7-bromo-N-(2-methoxyphenyl)-2-naphthalenecarboxamide

Naphthol AS-BI N-acetyl-β-D-galactosaminide

CAS: 59985-23-8

Naphthol AS-BI N-acetyl-β-D-galactosaminide

Molecular weight: 508.52g/mol

Ref: 54-BIB6121

Naphthol AS-BI N-acetyl-b-D-galactosaminide

CAS: 59985-23-8

Modified naphtol AS substrate used in histochemical and cytochemical staining

Formula: C₂₆H₂₇BrN₂O₈

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 575.41 g/mol

Ref: 3D-EN09607

Naphthol AS-BI N-acetyl-β-D-galactosaminide

CAS: 59985-23-8

Naphthol AS-BI N-acetyl-β-D-galactosaminide is a β-galactosaminidase substrate.The substrate is used in combination with stabilized diazonium salts such as Fast Red Violet LB salt (5-chloro-4-benzamido-2-methylbenzenediazonium chloride). Free Naphthol AS and Fast Red Violet undergo a chemical reaction to yield intensely colored azo-dyes.

Formula: C₂₆H₂₇BrN₂O₈

Purity: Min. 97.0 Area-%

Molecular weight: 575.41 g/mol

Ref: 3D-N-2000