
CAS 60-91-3
:Diethazine
Description:
Diethazine, with the CAS number 60-91-3, is a chemical compound classified as a phenothiazine derivative. It is primarily known for its use as an antihistamine and antiemetic agent. Diethazine exhibits a structure that includes a phenothiazine core, which contributes to its pharmacological properties. The compound is typically characterized by its ability to block histamine receptors, thereby alleviating allergic reactions and preventing nausea and vomiting. In terms of physical properties, diethazine is usually presented as a crystalline solid, with moderate solubility in water and higher solubility in organic solvents. Its chemical stability is generally good under standard conditions, although it should be stored away from light and moisture to prevent degradation. As with many pharmaceuticals, diethazine may have side effects, including sedation and potential interactions with other medications. Proper handling and dosage are essential to ensure safety and efficacy in its applications.
Formula:C18H22N2S
InChI:InChI=1S/C18H22N2S/c1-3-19(4-2)13-14-20-15-9-5-7-11-17(15)21-18-12-8-6-10-16(18)20/h5-12H,3-4,13-14H2,1-2H3
InChI key:InChIKey=LURMIKVZJSMXQE-UHFFFAOYSA-N
SMILES:C(CN(CC)CC)N1C=2C(SC=3C1=CC=CC3)=CC=CC2
Synonyms:- N-(2′-Diethylaminoethyl)dibenzoparathiazine
- N,N-Diethyl-10H-phenothiazine-10-ethanamine
- Diethazine
- Phenothiazine, 10-[2-(diethylamino)ethyl]-
- 10H-Phenothiazine-10-ethanamine, N,N-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
