CAS 600-05-5
:2,3-Dibromopropionic acid
Description:
2,3-Dibromopropionic acid is a halogenated organic compound characterized by the presence of two bromine atoms and a carboxylic acid functional group. Its molecular formula is C3H4Br2O2, indicating that it contains three carbon atoms, four hydrogen atoms, two bromine atoms, and two oxygen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its relatively high reactivity due to the presence of the bromine atoms, which can participate in various chemical reactions, including nucleophilic substitutions. 2,3-Dibromopropionic acid is soluble in polar solvents like water and alcohols, making it useful in organic synthesis and as an intermediate in the production of other chemical compounds. Additionally, it has applications in biochemical research, particularly in studies involving enzyme inhibition and metabolic pathways. However, due to its halogenated nature, it should be handled with care, as it may pose environmental and health risks.
Formula:C3H4Br2O2
InChI:InChI=1S/C3H4Br2O2/c4-1-2(5)3(6)7/h2H,1H2,(H,6,7)
InChI key:InChIKey=ZMYAKSMZTVWUJB-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CBr)Br
Synonyms:- (2R)-2,3-dibromopropanoate
- (2S)-2,3-dibromopropanoate
- (2S)-2,3-dibromopropanoic acid
- 2,3-Dibromoproanoic Acid
- 2,3-Dibromopropanoic Acid
- NSC 175
- Propanoic acid, 2,3-dibromo-
- Propionic acid, 2,3-dibromo-
- Propionic acid, α,β-dibromo-
- α,β-Dibromopropionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3-Dibromopropionic Acid
CAS:Formula:C3H4Br2O2Purity:>97.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:231.872,3-Dibromopropionic acid
CAS:Formula:C3H4Br2O2Purity:95%Color and Shape:SolidMolecular weight:231.87072,3-Dibromopropionic acid
CAS:2,3-Dibromopropionic acidPurity:98%Color and Shape:Pale Yellow SolidMolecular weight:231.87g/mol2,3-Dibromopropanoic Acid
CAS:Controlled ProductFormula:C3H4Br2O2Color and Shape:NeatMolecular weight:231.872,3-Dibromopropionic acid
CAS:Formula:C3H4Br2O2Purity:95%Color and Shape:SolidMolecular weight:231.8712,3-Dibromopropanoic acid
CAS:<p>2,3-Dibromopropanoic acid is a carcinogenic chemical that has been shown to cause liver tumors in rats. It is a nucleophile that reacts with amide groups to form an amide bond. The analytical method for 2,3-dibromopropanoic acid is gas chromatography with flame ionization detection. Its structural formula is CHBrCHBrCOH. It has a carbonyl group and acidic properties, as well as a chloride ion present on the molecule. 2,3-Dibromopropanoic acid is an anxiolytic drug that has been shown to have health effects such as drowsiness and headache.</p>Formula:C3H4Br2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:231.87 g/molRef: 3D-FD37217
Discontinued product





