CAS 600-17-9
:2-Hydroxy-3-butenoic Acid
Description:
2-Hydroxy-3-butenoic acid, also known as 3-hydroxy-2-butenoic acid, is an organic compound characterized by its carboxylic acid functional group and an alcohol group adjacent to a double bond. This compound features a four-carbon backbone with a hydroxyl (-OH) group at the second carbon and a double bond between the second and third carbons, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its state, and is soluble in water due to the presence of the hydroxyl group. The compound can participate in various chemical reactions, including esterification and dehydration, making it useful in the synthesis of more complex molecules. Its CAS number, 600-17-9, is a unique identifier that facilitates its identification in chemical databases. Due to its structural features, 2-hydroxy-3-butenoic acid may also exhibit biological activity, although specific applications and effects would depend on further research and context.
Formula:C4H6O3
InChI:InChI=1/C4H6O3/c1-2-3(5)4(6)7/h2-3,5H,1H2,(H,6,7)
SMILES:C=CC(C(=O)O)O
Synonyms:- Vinylglycolic acid
- 2-Hydroxybut-3-Enoic Acid
- 2-Hydroxy-3-butenoic acid
- 3-Butenoic acid,2-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.