CAS 600-35-1

3,3-dibromo-2-oxopropanoic acid

Description:

3,3-Dibromo-2-oxopropanoic acid, with the CAS number 600-35-1, is an organic compound characterized by the presence of two bromine atoms and a keto group in its structure. It is a derivative of propanoic acid, featuring a carboxylic acid functional group, which contributes to its acidic properties. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in the field of organic chemistry. This compound is typically a white to off-white solid and is soluble in polar solvents due to its carboxylic acid group. Its reactivity can be attributed to the electrophilic nature of the carbonyl group and the halogen substituents, allowing it to participate in nucleophilic substitution and addition reactions. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, 3,3-dibromo-2-oxopropanoic acid serves as an important intermediate in the synthesis of more complex organic molecules.

Formula: C₃H₂Br₂O₃

InChI: InChI=1/C3H2Br2O3/c4-2(5)1(6)3(7)8/h2H,(H,7,8)

SMILES: C(=O)(C(Br)Br)C(=O)O

dibromopyruvic acid

CAS: 600-35-1

Formula: C₃H₂Br₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 245.8542

Ref: IN-DA00EIFR

3,3-Dibromo-2-oxopropanoic acid

CAS: 600-35-1

3,3-Dibromo-2-oxopropanoic acid

Purity: 95%

Molecular weight: 245.85g/mol

Ref: 54-OR1073101

3,3-Dibromo-2-Oxopropanoic Acid

CAS: 600-35-1

Formula: C₃H₂Br₂O₃

Molecular weight: 245.85

Ref: 4Z-P-180014

3,3-Dibromo-2-oxopropanoic Acid

Controlled Product

CAS: 600-35-1

Applications 3,3-Dibromo-2-oxopropanoic acid is a useful research chemical, a cytochrome b2 inhibitor.
References Kulys, J.: Bioorganicheskaya Khimiya, 5, 1196 (1979)

Formula: C₃H₂Br₂O₃

Color and Shape: Neat

Molecular weight: 245.854

Ref: TR-D426785