CAS 600-40-8
:1,1-Dinitroethane
Description:
1,1-Dinitroethane is an organic compound characterized by the presence of two nitro groups attached to the first carbon of an ethane backbone. Its molecular formula is C2H4N2O4, indicating that it contains carbon, hydrogen, nitrogen, and oxygen. This compound is typically a colorless to pale yellow liquid with a sweet odor, and it is known for its explosive properties, particularly when subjected to heat or shock. 1,1-Dinitroethane is relatively soluble in organic solvents but has limited solubility in water. It is primarily used in research and development, particularly in the field of explosives and propellants. The compound is sensitive to impact and friction, which necessitates careful handling and storage. Additionally, it can undergo various chemical reactions, including reduction and substitution, making it a versatile intermediate in organic synthesis. Due to its potential hazards, appropriate safety measures should be taken when working with this substance.
Formula:C2H4N2O4
InChI:InChI=1S/C2H4N2O4/c1-2(3(5)6)4(7)8/h2H,1H3
InChI key:InChIKey=LKKHEZBRRGJBGH-UHFFFAOYSA-N
SMILES:C(N(=O)=O)(N(=O)=O)C
Synonyms:- Ethane, 1,1-dinitro-
- 1,1-Dinitroethane
- NSC 16150
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
