CAS 60003-46-5

[4-(hexyloxy)phenyl]acetic acid

Description:

[4-(Hexyloxy)phenyl]acetic acid, with the CAS number 60003-46-5, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with a hexyloxy group at the para position and an acetic acid moiety. This compound is typically a white to off-white solid, exhibiting moderate solubility in organic solvents due to its hydrophobic hexyloxy chain, while its carboxylic acid group can engage in hydrogen bonding, enhancing its solubility in polar solvents. The presence of the hexyloxy group contributes to its lipophilicity, which may influence its biological activity and interactions with cellular membranes. The compound may exhibit properties such as anti-inflammatory or analgesic effects, making it of interest in pharmaceutical research. Additionally, its structural features allow for potential applications in materials science, particularly in the development of surfactants or polymer additives. As with many organic compounds, handling should be conducted with care, considering safety data and potential environmental impacts.

Formula: C₁₄H₂₀O₃

InChI: InChI=1/C14H20O3/c1-2-3-4-5-10-17-13-8-6-12(7-9-13)11-14(15)16/h6-9H,2-5,10-11H2,1H3,(H,15,16)

SMILES: CCCCCCOc1ccc(cc1)CC(=O)O

2-[4-(Hexyloxy)phenyl]acetic acid

CAS: 60003-46-5

Versatile small molecule scaffold

Formula: C₁₄H₂₀O₃

Purity: Min. 95%

Molecular weight: 236.31 g/mol

Ref: 3D-KCA00346