CAS 60008-01-7
:(1S)-8-hydroxy-1-(4-hydroxybenzyl)-7-methoxy-2,2-dimethyl-1,2,3,4-tetrahydroisoquinolinium
Description:
(1S)-8-hydroxy-1-(4-hydroxybenzyl)-7-methoxy-2,2-dimethyl-1,2,3,4-tetrahydroisoquinolinium is a complex organic compound characterized by its tetrahydroisoquinoline structure, which is a bicyclic framework commonly found in various natural products and pharmaceuticals. This compound features multiple functional groups, including a hydroxyl group (-OH) and a methoxy group (-OCH3), which contribute to its potential biological activity and solubility properties. The presence of the 4-hydroxybenzyl moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The stereochemistry indicated by the (1S) configuration implies specific spatial arrangements that can influence the compound's reactivity and interactions. Additionally, the dimethyl substitution at the 2-position of the tetrahydroisoquinoline ring may enhance its lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's unique structural features may confer specific therapeutic potentials, warranting further investigation in drug development and biological studies.
Formula:C19H24NO3
InChI:InChI=1/C19H23NO3/c1-20(2)11-10-14-6-9-17(23-3)19(22)18(14)16(20)12-13-4-7-15(21)8-5-13/h4-9,16H,10-12H2,1-3H3,(H-,21,22)/p+1/t16-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Oblongine
CAS:Oblongine chloride lowers blood pressure in a dose-dependent manner without affecting α2-adrenergic receptors.Formula:C19H24NO3Purity:98%Color and Shape:SolidMolecular weight:314.404Oblongine
CAS:Oblongine is a synthetic compound, which is derived from a series of chemical modifications to naturally occurring alkaloids. Its mode of action involves selective interaction with neurotransmitter systems, primarily enhancing synaptic efficiency through the modulation of receptor activity and neurotransmitter release. The compound binds to specific sites in the central nervous system, promoting neuroplasticity and boosting cognitive processes.
Formula:C19H24NO3Purity:Min. 95%Molecular weight:314.4 g/mol


