CAS 60010-03-9

2,6-Dichloro-4-methyl-3-nitropyridine

Description:

2,6-Dichloro-4-methyl-3-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with chlorine atoms, at the 4 position with a methyl group, and at the 3 position with a nitro group. This compound typically appears as a solid and is known for its pale yellow to brown color. It has a molecular formula that reflects its complex structure, contributing to its unique chemical properties. The presence of both electron-withdrawing groups (the nitro and chloro substituents) and an electron-donating group (the methyl group) influences its reactivity and potential applications in organic synthesis and pharmaceuticals. 2,6-Dichloro-4-methyl-3-nitropyridine is often utilized in the development of agrochemicals and as an intermediate in the synthesis of various organic compounds. Its solubility in organic solvents and stability under standard conditions make it a valuable compound in chemical research and industrial applications. Safety precautions should be observed when handling this substance due to its potential toxicity and environmental impact.

Formula: C₆H₄Cl₂N₂O₂

InChI: InChI=1/C6H4Cl2N2O2/c1-3-2-4(7)9-6(8)5(3)10(11)12/h2H,1H3

SMILES: Cc1cc(Cl)nc(c1N(=O)=O)Cl

Synonyms:

• Pyridine, 2,6-Dichloro-4-Methyl-3-Nitro-

2,6-Dichloro-4-methyl-3-nitropyridine

CAS: 60010-03-9

Formula: C₆H₄Cl₂N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 207.0142

Ref: IN-DA003315

2,6-Dichloro-4-methyl-3-nitropyridine

CAS: 60010-03-9

2,6-Dichloro-4-methyl-3-nitropyridine

Formula: C₆H₄Cl₂N₂O₂

Purity: 97%

Color and Shape: light yellow solid

Molecular weight: 207.01416g/mol

Ref: 54-OR305051

2,6-Dichloro-4-methyl-3-nitropyridine

CAS: 60010-03-9

Formula: C₆H₄Cl₂N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 207.01

Ref: 10-F210626