CAS 600141-83-1

2,2-dimethyl-4,30-dioxo-3,8,11,14,17,20,23,26,32-nonaoxa-5,29-diazatetratriacontan-34-oic acid

Description:

2,2-Dimethyl-4,30-dioxo-3,8,11,14,17,20,23,26,32-nonaoxa-5,29-diazatetratriacontan-34-oic acid, with CAS number 600141-83-1, is a complex organic compound characterized by its extensive carbon chain and multiple functional groups. This substance features a long aliphatic structure, which includes both ester and amide linkages due to the presence of dioxo and diaza groups. The presence of multiple ether linkages (indicated by the "nonaoxa" descriptor) suggests that it may exhibit significant solubility in polar solvents. The compound's dioxo functional groups imply potential reactivity, particularly in forming coordination complexes or participating in various chemical reactions. Its structural complexity may also confer unique properties, such as specific biological activity or utility in materials science. However, detailed studies would be necessary to fully understand its physical and chemical properties, including melting point, boiling point, solubility, and potential applications in various fields such as pharmaceuticals or polymer chemistry.

Formula: C₂₅H₄₈N₂O₁₃

InChI: InChI=1/C25H48N2O13/c1-25(2,3)40-24(31)27-5-7-33-9-11-35-13-15-37-17-19-38-18-16-36-14-12-34-10-8-32-6-4-26-22(28)20-39-21-23(29)30/h4-21H2,1-3H3,(H,26,28)(H,27,31)(H,29,30)

SMILES: CC(C)(C)OC(=NCCOCCOCCOCCOCCOCCOCCOCCN=C(COCC(=O)O)O)O

O-(N-Boc-2-aminoethyl)-O'-(N-diglycolyl-2-aminoethyl)hexaethyleneglycol

CAS: 600141-83-1

O-(N-Boc-2-aminoethyl)-O'-(N-diglycolyl-2-aminoethyl)hexaethyleneglycol is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. O-(N-Boc-2-aminoethyl)-O'-(N-diglycolyl-2-aminoethyl)hexaethyleneglycol is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₂₅H₄₈N₂O₁₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 584.65 g/mol

Ref: 3D-FB49691