CAS 60025-09-4

4-Amino-6-chloropyrimidine-5-carbonitrile

Description:

4-Amino-6-chloropyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both amino and cyano functional groups. The presence of the amino group at the 4-position and the cyano group at the 5-position contributes to its reactivity and potential applications in medicinal chemistry and agrochemicals. The chlorine atom at the 6-position enhances its electrophilic properties, making it a useful intermediate in the synthesis of various pharmaceuticals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure allows for various chemical modifications, which can lead to the development of derivatives with enhanced biological activity. Additionally, due to the presence of multiple functional groups, it may participate in a range of chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken during use.

Formula: C₅H₃ClN₄

InChI: InChI=1/C5H3ClN4/c6-4-3(1-7)5(8)10-2-9-4/h2H,(H2,8,9,10)

SMILES: C(#N)c1c(Cl)nc[nH]c1=N

Synonyms:

• 5-Pyrimidinecarbonitrile, 4-Amino-6-Chloro-

4-Amino-6-chloropyrimidine-5-carbonitrile

CAS: 60025-09-4

Formula: C₅H₃ClN₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.5571

Ref: IN-DA00EICY

4-Amino-6-chloropyrimidine-5-carbonitrile

CAS: 60025-09-4

4-Amino-6-chloropyrimidine-5-carbonitrile

Purity: 96%

Color and Shape: Pale Yellow Powder

Molecular weight: 154.56g/mol

Ref: 54-OR301091

4-Amino-6-chloropyrimidine-5-carbonitrile

CAS: 60025-09-4

Formula: C₅H₃ClN₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.56

Ref: 10-F068741