
CAS 6003-11-8
:Alizarin 2-methyl ether
Description:
Alizarin 2-methyl ether, also known as 1,2-dihydroxy-4-methoxyanthraquinone, is an organic compound belonging to the anthraquinone family. It is characterized by its vibrant red to reddish-brown color, which makes it useful as a dye and pigment in various applications, including textiles and art materials. The compound features two hydroxyl (-OH) groups and a methoxy (-OCH3) group, contributing to its solubility and reactivity. Alizarin 2-methyl ether exhibits good stability under normal conditions but may undergo degradation when exposed to strong acids or bases. Its chemical structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, it has potential applications in biological systems, where it may exhibit antioxidant properties. Safety data indicates that, like many organic compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, Alizarin 2-methyl ether is a significant compound in both industrial and research settings due to its unique properties and applications.
Formula:C15H10O4
InChI:InChI=1S/C15H10O4/c1-19-11-7-6-10-12(15(11)18)14(17)9-5-3-2-4-8(9)13(10)16/h2-7,18H,1H3
InChI key:InChIKey=BYQWRZGQEZAOPQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC=C(OC)C2O
Synonyms:- Anthraquinone, 1-hydroxy-2-methoxy-
- 9,10-Anthracenedione, 1-hydroxy-2-methoxy-
- 1-Hydroxy-2-methoxyanthraquinone
- Alizarin 2-methyl ether
- 1-Hydroxy-2-methoxy-9,10-anthracenedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Alizarin 2-methyl ether
CAS:Alizarin 2-methyl ether is a useful organic compound for research related to life sciences. The catalog number is T124579 and the CAS number is 6003-11-8.Formula:C15H10O4Color and Shape:SolidMolecular weight:254.241
