CAS 6003-94-7

Chelidonic acid monohydrate

Description:

Chelidonic acid monohydrate, with the CAS number 6003-94-7, is a chemical compound that belongs to the class of dicarboxylic acids. It is characterized by its structure, which includes two carboxylic acid functional groups, contributing to its acidic properties. The monohydrate form indicates the presence of one molecule of water associated with each molecule of chelidonic acid, which can influence its solubility and stability. This compound is typically a white crystalline solid and is soluble in water, making it useful in various chemical applications. Chelidonic acid is known for its potential biological activities, including its role in chelation, where it can bind metal ions, which may have implications in medicinal chemistry and environmental science. Its reactivity and functional groups allow it to participate in various organic reactions, making it a valuable intermediate in synthetic chemistry. As with many chemical substances, handling precautions should be observed due to its acidic nature and potential reactivity.

Formula: C₇H₂O₆

InChI: InChI=1/C7H4O6/c8-3-1-4(6(9)10)13-5(2-3)7(11)12/h1-2H,(H,9,10)(H,11,12)/p-2

SMILES: c1c(=O)cc(C(=O)[O-])oc1C(=O)[O-]

Synonyms:

• 4H-pyran-2,6-dicarboxylic acid, 4-oxo-
• 4-Oxo-4H-pyran-2,6-dicarbons?ure
• Acide 4-oxo-4H-pyran-2,6-dicarboxylique
• 4-oxo-4H-pyran-2,6-dicarboxylic acid monohydrate
• 4-oxo-4H-pyran-2,6-dicarboxylate

Chelidonic Acid Monohydrate

CAS: 6003-94-7

Formula: C₇H₄O₆·H₂O

Purity: >95.0%(T)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 202.12

Ref: 3B-C0955

Chelidonic Acid Monohydrate

CAS: 6003-94-7

Formula: C₇H₆O₇

Purity: 95%

Color and Shape: Solid

Molecular weight: 202.1183

Ref: IN-DA003ORW

4-Oxo-4H-pyran-2,6-dicarboxylic acid monohydrate

CAS: 6003-94-7

4-Oxo-4H-pyran-2,6-dicarboxylic acid monohydrate

Formula: C₇H₄O₆·H₂O

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 202.12g/mol

Ref: 54-OR46508

4-Oxo-4H-pyran-2,6-dicarboxylic acid monohydrate

CAS: 6003-94-7

Formula: C₇H₆O₇

Purity: 95%

Color and Shape: Solid, Very pale yellow to pale yellow powder

Molecular weight: 202.118

Ref: 10-F092494

Chelidonic acid monohydrate

CAS: 6003-94-7

Chelidonic acid monohydrate is an organometallic compound that can be synthesized by reacting 4-hydroxybenzoic acid with an organometallic reagent. Chelidonic acid monohydrate has antihypertensive activity and is used in the treatment of viral infections. Chelidonic acid monohydrate has a hydroxy group on the skeleton, which is a molecule that contains two or more amino groups. It also has a carboxylic group and alkynyl group, which are both organic functional groups that contain at least one carbon atom bonded to a hydroxyl group. Chelidonic acid monohydrate is a metal complex with calixarenes as ligands, which are heterocycles that have six members in their ring system. Chelidonic acid monohydrate is also cisplatin-resistant and can be used for the treatment of cancers such as breast cancer and leukemia.

Purity: Min. 95%

Ref: 3D-FC02815