CAS 60032-63-5
:4-Hydroxy-3-iodobenzaldehyde
Description:
4-Hydroxy-3-iodobenzaldehyde, with the CAS number 60032-63-5, is an organic compound characterized by the presence of a hydroxyl group (-OH), an iodine atom, and an aldehyde functional group (-CHO) attached to a benzene ring. This compound typically appears as a solid and is soluble in organic solvents. Its molecular structure features a phenolic hydroxyl group at the para position relative to the aldehyde, and an iodine substituent at the meta position, which influences its reactivity and properties. The presence of the iodine atom can enhance the compound's electrophilic character, making it useful in various chemical reactions, including electrophilic aromatic substitution. Additionally, the hydroxyl group contributes to its potential as a ligand in coordination chemistry and its utility in organic synthesis. 4-Hydroxy-3-iodobenzaldehyde may also exhibit biological activity, making it of interest in medicinal chemistry and research applications. Proper handling and storage are essential due to its reactivity and potential hazards associated with iodine-containing compounds.
Formula:C7H5IO2
InChI:InChI=1/C7H5IO2/c8-6-3-5(4-9)1-2-7(6)10/h1-4,10H
SMILES:c1cc(c(cc1C=O)I)O
Synonyms:- 3-Iodo-4-hydroxybenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzaldehyde, 4-hydroxy-3-iodo-
CAS:Formula:C7H5IO2Purity:97%Color and Shape:SolidMolecular weight:248.01793-Iodo-4-hydroxybenzaldehyde
CAS:Controlled ProductFormula:C7H5IO2Color and Shape:NeatMolecular weight:248.023-Iodo-4-hydroxybenzaldehyde
CAS:3-Iodo-4-hydroxybenzaldehyde (3IB) is an amide that is found in plant tissue. It has been shown to have a number of biological activities, including hypoiodous acid production, chromatographic activity, and ether extract activity. 3IB can be synthesized from benzofuran derivatives or by treating the corresponding nitrobenzene with hydrochloric acid. Bioassays using thyroid enzyme have shown that 3IB may inhibit the synthesis of daunorubicin, a potent antitumour drug. Molecular modelling studies suggest that 3IB binds to ATP synthase by forming hydrogen bonds with the amino acids Gly and His in the active site.Formula:C7H5IO2Purity:90%Color and Shape:PowderMolecular weight:248.02 g/mol4-Hydroxy-3-iodobenzaldehyde
CAS:Formula:C7H5IO2Purity:95%Color and Shape:SolidMolecular weight:248.019




