CAS 6005-95-4

2-oxo-5-phenyltetrahydrofuran-3-carboxylic acid

Description:

2-Oxo-5-phenyltetrahydrofuran-3-carboxylic acid, with the CAS number 6005-95-4, is a chemical compound characterized by its unique structural features, including a tetrahydrofuran ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both cyclic and aromatic systems, contributing to its reactivity and potential applications in organic synthesis. The presence of the phenyl group enhances its stability and may influence its solubility in various solvents. As a carboxylic acid, it can participate in acid-base reactions and form esters or amides under appropriate conditions. The keto group (2-oxo) adds to its reactivity, allowing for further transformations such as nucleophilic additions. This compound may be of interest in medicinal chemistry and materials science due to its structural complexity and potential biological activity. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₁H₁₀O₄

InChI: InChI=1/C11H10O4/c12-10(13)8-6-9(15-11(8)14)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,12,13)

SMILES: c1ccc(cc1)C1CC(C(=O)O)C(=O)O1

2-Oxo-5-phenyloxolane-3-carboxylic acid

CAS: 6005-95-4

Versatile small molecule scaffold

Formula: C₁₁H₁₀O₄

Purity: Min. 95%

Molecular weight: 206.19 g/mol

Ref: 3D-GAA00595