CAS 60058-17-5

4-Hydroxy-1,6-naphthyridin-2(1H)-one

Description:

4-Hydroxy-1,6-naphthyridin-2(1H)-one, with the CAS number 60058-17-5, is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. This compound features a hydroxyl group (-OH) at the 4-position and a carbonyl group (C=O) at the 2-position, contributing to its reactivity and potential biological activity. It is typically a crystalline solid, exhibiting solubility in polar solvents due to the presence of the hydroxyl group. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of nitrogen in the ring system can influence its electronic properties, making it a candidate for further studies in coordination chemistry and material science. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₈H₆N₂O₂

InChI: InChI=1S/C8H6N2O2/c11-7-3-8(12)10-6-1-2-9-4-5(6)7/h1-4H,(H2,10,11,12)

InChI key: InChIKey=CBNDBUJADLVUBV-UHFFFAOYSA-N

SMILES: OC=1C=2C(NC(=O)C1)=CC=NC2

Synonyms:

• 2,4-Dihydroxy-1,6-naphthyridine
• 1,6-Naphthyridin-2(1H)-one, 4-hydroxy-
• 4-Hydroxy-1,6-naphthyridin-2(1H)-one
• 1,6-Naphthyridine-2,4-diol

1,6-Naphthyridine-2,4-diol

CAS: 60058-17-5

1,6-Naphthyridine-2,4-diol is a trifluoromethyl carboxylic acid that is used in the synthesis of pharmaceuticals. The compound is a carboxylic acid type cation with an integer number of 2 and 4 carbon atoms. 1,6-Naphthyridine-2,4-diol is also known to produce symptoms such as sensitivity and prophylactically for allergy.
!-- More -->

Formula: C₈H₆N₂O₂

Purity: Min. 95%

Molecular weight: 162.15 g/mol

Ref: 3D-KCA05817