CAS 6006-06-0
:(5E)-5-(5-bromo-2,4-dimethoxybenzylidene)-1-(4-methoxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione
Description:
The chemical substance known as (5E)-5-(5-bromo-2,4-dimethoxybenzylidene)-1-(4-methoxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione, with the CAS number 6006-06-0, is a complex organic compound characterized by its pyrimidine core structure, which is substituted at various positions. The presence of multiple methoxy groups and a bromine atom contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. The pyrimidine ring is known for its role in various biological processes, and the specific substitutions can influence the compound's interaction with biological targets. Additionally, the compound's stability, melting point, and solubility in different solvents can vary based on its molecular structure and the presence of functional groups. Overall, this substance represents a class of compounds that may have applications in pharmaceuticals or as intermediates in organic synthesis.
Formula:C20H17BrN2O6
InChI:InChI=1/C20H17BrN2O6/c1-27-13-6-4-12(5-7-13)23-19(25)14(18(24)22-20(23)26)8-11-9-15(21)17(29-3)10-16(11)28-2/h4-10H,1-3H3,(H,22,24,26)/b14-8+
Synonyms:- 2,4,6(1H,3H,5H)-pyrimidinetrione, 5-[(5-bromo-2,4-dimethoxyphenyl)methylene]-1-(4-methoxyphenyl)-, (5E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
12-Tridecanoic acid
CAS:12-Tridecanoic acid is a saturated fatty acid, which is typically derived from natural sources such as vegetable oils or synthesized through organic chemical methods. This compound is characterized by its twelve-carbon chain, which imparts unique physicochemical properties. The mode of action of 12-Tridecanoic acid involves its integration into lipid bilayers, influencing membrane fluidity and participating in cellular signaling pathways. It can also act as a precursor for the synthesis of other complex molecules, thereby playing a crucial role in metabolic processes.Purity:Min. 95%





