CAS 60061-68-9: 4-Bromo-3-methyl-5-(trifluoromethyl)-1H-pyrazole
Description:4-Bromo-3-methyl-5-(trifluoromethyl)-1H-pyrazole is a heterocyclic organic compound characterized by its pyrazole ring, which consists of two adjacent nitrogen atoms within a five-membered ring. The presence of a bromine atom at the 4-position and a trifluoromethyl group at the 5-position significantly influences its chemical properties, including its reactivity and polarity. The trifluoromethyl group is known for imparting unique electronic characteristics, enhancing lipophilicity and stability against oxidation. This compound is typically used in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its molecular structure allows for interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations in its practical applications. Overall, 4-Bromo-3-methyl-5-(trifluoromethyl)-1H-pyrazole is a versatile compound with significant implications in chemical research and development.
Formula:C5H4BrF3N2
InChI:InChI=1S/C5H4BrF3N2/c1-2-3(6)4(11-10-2)5(7,8)9/h1H3,(H,10,11)
InChI key:InChIKey=PDSOUBXNWWZCNB-UHFFFAOYSA-N
SMILES:FC(F)(F)C=1NN=C(C1Br)C
- Synonyms:
- 1H-Pyrazole, 4-bromo-3-methyl-5-(trifluoromethyl)-
- 4-Bromo-5-methyl-3-trifluoromethyl-2H-pyrazole
- 4-bromo-5-methyl-3-(trifluoromethyl)-1H-pyrazole
- 4-Bromo-3-methyl-5-(trifluoromethyl)-1H-pyrazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Bromo-3-methyl-5-(trifluoromethyl)pyrazole REF: 3B-B4770CAS: 60061-68-9 | >98.0%(GC) | 80.00 € | Tue 22 Apr 25 |
![]() | 4-Bromo-5-methyl-3-trifluoromethylpyrazole REF: 10-F010431CAS: 60061-68-9 | 97.0% | 24.00 €~156.00 € | Wed 30 Apr 25 |
![]() | 4-Bromo-5-methyl-3-(trifluoromethyl)-1H-pyrazole REF: 54-PC0102CAS: 60061-68-9 | 95% | To inquire | Tue 06 May 25 |
![]() | 4-bromo-5-methyl-3-(trifluoromethyl)-1h-pyrazole REF: 3D-FB105709CAS: 60061-68-9 | Min. 95% | - - - | Discontinued product |

4-Bromo-3-methyl-5-(trifluoromethyl)pyrazole
Ref: 3B-B4770
1g | 80.00 € |

4-Bromo-5-methyl-3-trifluoromethylpyrazole
Ref: 10-F010431
1g | 24.00 € | ||
5g | 36.00 € | ||
25g | 156.00 € |

4-Bromo-5-methyl-3-(trifluoromethyl)-1H-pyrazole
Ref: 54-PC0102
Undefined size | To inquire |

4-bromo-5-methyl-3-(trifluoromethyl)-1h-pyrazole
Ref: 3D-FB105709
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |