CymitQuimica logo

CAS 60075-23-2

:

3,4-Dimethoxyphenylacetic acid hydrazide

Description:
3,4-Dimethoxyphenylacetic acid hydrazide is an organic compound characterized by the presence of a hydrazide functional group attached to a phenylacetic acid moiety that features two methoxy groups at the 3 and 4 positions of the aromatic ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of the hydrazide group suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of anti-inflammatory or antimicrobial agents. The compound's molecular structure contributes to its chemical properties, influencing its reactivity, stability, and interaction with biological systems. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C10H14N2O3
InChI:InChI=1/C10H14N2O3/c1-14-8-4-3-7(5-9(8)15-2)6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13)
InChI key:HRMXYTRKEOUMNG-UHFFFAOYSA-N
SMILES:COc1ccc(cc1OC)CC(=NN)O
Synonyms:
  • 3,4-Dimethoxyphenylacethydrazide~Homoveratric acid hydrazide
  • 2-(3,4-Dimethoxyphenyl)Acetohydrazide
Found 5 products.