CAS 6008-91-9
:Methacryloyl-CoA
Description:
Methacryloyl-CoA, with the CAS number 6008-91-9, is a biochemical compound that plays a significant role in metabolic pathways, particularly in the context of fatty acid metabolism and the biosynthesis of certain biomolecules. It is an acyl-CoA derivative of methacrylic acid, characterized by the presence of a methacryloyl group attached to coenzyme A (CoA). This compound is typically involved in enzymatic reactions where it serves as a substrate or intermediate. Methacryloyl-CoA is known for its reactivity due to the presence of the double bond in the methacryloyl moiety, which can participate in various chemical reactions, including polymerization and acylation processes. In biological systems, it may be involved in the synthesis of methacrylate polymers or other derivatives, contributing to cellular functions and metabolic regulation. Its stability and reactivity are influenced by the surrounding environment, including pH and temperature, which can affect its behavior in both laboratory and physiological conditions.
Formula:C25H40N7O17P3S
InChI:InChI=1S/C25H40N7O17P3S/c1-13(2)24(37)53-8-7-27-15(33)5-6-28-22(36)19(35)25(3,4)10-46-52(43,44)49-51(41,42)45-9-14-18(48-50(38,39)40)17(34)23(47-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-12,14,17-19,23,34-35H,1,5-10H2,2-4H3,(H,27,33)(H,28,36)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/t14-,17-,18-,19+,23-/m1/s1
InChI key:InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](COP(OP(OCC([C@H](C(NCCC(NCCSC(C(C)=C)=O)=O)=O)O)(C)C)(=O)O)(=O)O)[C@H]1OP(=O)(O)O
Synonyms:- Methacryloyl-CoA
- Coenzyme A, S-(2-methyl-2-propenoate)
- Coenzyme A, S-methacrylate
- Methylacrylyl-CoA
- Methacrylyl coenzyme A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methylacrylyl-CoA
CAS:Controlled Product<p>Applications Methacrylyl-CoA is an intermediate in the serine cycle that converts acetyl CoA (acetyl-CoA) to glyoxylate.<br>References Korotkova, N., et al.: J. Bacteriol., 184, 1750 (2002)<br></p>Formula:C25H40N7O17P3SColor and Shape:NeatMolecular weight:835.61
