CAS 60082-02-2
:1-methyl-2,3-dihydro-1H-indole-5-carbaldehyde
Description:
1-Methyl-2,3-dihydro-1H-indole-5-carbaldehyde, with the CAS number 60082-02-2, is an organic compound that features a bicyclic indole structure. This compound is characterized by the presence of a methyl group at the nitrogen atom of the indole ring and an aldehyde functional group at the 5-position. The dihydro form indicates that the compound has two hydrogen atoms added to the indole structure, resulting in a saturated ring system. This compound is typically a pale yellow to brown liquid or solid, depending on its purity and form. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of both the indole and aldehyde functionalities allows for diverse reactivity, making it a valuable building block in synthetic chemistry. Additionally, it may exhibit biological activity, although specific biological properties would require further investigation. Proper handling and storage are essential due to its reactive nature and potential hazards associated with aldehyde compounds.
Formula:C10H11NO
InChI:InChI=1/C10H11NO/c1-11-5-4-9-6-8(7-12)2-3-10(9)11/h2-3,6-7H,4-5H2,1H3
SMILES:CN1CCc2cc(ccc12)C=O
Synonyms:- 1H-indole-5-carboxaldehyde, 2,3-dihydro-1-methyl-
- 1-Methyl-5-indolinecarbaldehyde
- 1-Methylindoline-5-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Methylindoline-5-carboxaldehyde
CAS:1-Methylindoline-5-carboxaldehydeFormula:C10H11NOPurity:97%Color and Shape: yellow to green low melting solidMolecular weight:161.20g/mol1-Methylindoline-5-carbaldehyde
CAS:1-Methylindoline-5-carbaldehyde is a chemical compound that has been used in cellular biology to study the effects of membrane potential on conformational changes. It has also been used to measure anilines, which are compounds with a dihedral angle between their two substituents. The molecule fluoresces and can be detected using microscope and analytical chemistry techniques such as monitoring. 1-Methylindoline-5-carbaldehyde has been shown to have photophysical properties, where it can emit light when excited by a photon. This chemical compound can also be used in conformational analysis, due to its ability to change shape in response to physical or chemical stimuli.Formula:C10H11NOPurity:Min. 95%Molecular weight:161.2 g/mol


